(S)-N-(cyanomethyl)-4-fluoro-4-methyl-2-((S)-2,2,2-trifluoro-1-(4'-(piperazin-1-yl)biphenyl-4-yl)ethylamino)pentanamide

ID: ALA4557939

PubChem CID: 155554760

Max Phase: Preclinical

Molecular Formula: C26H31F4N5O

Molecular Weight: 505.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(F)C[C@H](N[C@@H](c1ccc(-c2ccc(N3CCNCC3)cc2)cc1)C(F)(F)F)C(=O)NCC#N

Standard InChI:  InChI=1S/C26H31F4N5O/c1-25(2,27)17-22(24(36)33-12-11-31)34-23(26(28,29)30)20-5-3-18(4-6-20)19-7-9-21(10-8-19)35-15-13-32-14-16-35/h3-10,22-23,32,34H,12-17H2,1-2H3,(H,33,36)/t22-,23-/m0/s1

Standard InChI Key:  ZKEJUNBGGJXXPG-GOTSBHOMSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   32.5789   -5.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5778   -6.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2858   -7.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9955   -6.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9927   -5.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2840   -5.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6958   -5.4925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4053   -5.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1110   -5.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1084   -4.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3942   -4.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6914   -4.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8140   -4.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5238   -4.6642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8098   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5154   -3.0299    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.1000   -3.0371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.8025   -2.6208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.2294   -4.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9392   -4.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6448   -4.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9433   -5.4742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2252   -3.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9308   -3.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9267   -2.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6406   -3.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6338   -2.6084    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.3546   -4.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0602   -4.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7617   -3.8239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8733   -7.1313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1661   -6.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4601   -7.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4553   -7.9421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1625   -8.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8746   -7.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 10 13  1  0
 13 14  1  0
 13 15  1  1
 15 16  1  0
 15 17  1  0
 15 18  1  0
 14 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 19 23  1  1
 23 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 21 28  1  0
 28 29  1  0
 29 30  3  0
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
  2 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557939

    ---

Associated Targets(Human)

CTSL Tclin Cathepsin L (3852 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CTSB Tchem Cathepsin B (3822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cruzipain (33337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.56Molecular Weight (Monoisotopic): 505.2465AlogP: 4.10#Rotatable Bonds: 9
Polar Surface Area: 80.19Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.42CX Basic pKa: 8.88CX LogP: 3.37CX LogD: 1.88
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.93

References

1. Cianni L, Feldmann CW, Gilberg E, Gütschow M, Juliano L, Leitão A, Bajorath J, Montanari CA..  (2019)  Can Cysteine Protease Cross-Class Inhibitors Achieve Selectivity?,  62  (23): [PMID:31361135] [10.1021/acs.jmedchem.9b00683]

Source