The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-Amino-5-(7-methoxy-5-methylbenzo[b]thiophen-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)pyrrolidin-1-yl)-2-((dimethylamino)methyl)prop-2-en-1-one ID: ALA4557987
PubChem CID: 155554550
Max Phase: Preclinical
Molecular Formula: C26H30N6O2S
Molecular Weight: 490.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(CN(C)C)C(=O)N1CCC(n2cc(-c3cc4cc(C)cc(OC)c4s3)c3c(N)ncnc32)C1
Standard InChI: InChI=1S/C26H30N6O2S/c1-15-8-17-10-21(35-23(17)20(9-15)34-5)19-13-32(25-22(19)24(27)28-14-29-25)18-6-7-31(12-18)26(33)16(2)11-30(3)4/h8-10,13-14,18H,2,6-7,11-12H2,1,3-5H3,(H2,27,28,29)
Standard InChI Key: FVECKDIACHPELI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
34.7664 -16.4016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7652 -17.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4774 -17.6383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4756 -15.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1883 -16.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1931 -17.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9773 -17.4692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4588 -16.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9695 -16.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4732 -15.1714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2175 -15.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9948 -15.1011 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.7308 -14.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2072 -14.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9882 -14.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5943 -13.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4206 -12.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6353 -12.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0326 -13.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3770 -13.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5511 -14.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4580 -11.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2385 -18.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7618 -18.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2501 -19.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0259 -19.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0210 -18.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7340 -19.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7340 -20.5495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4459 -19.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4459 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1577 -19.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8696 -19.3196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5814 -19.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8696 -18.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
9 11 1 0
11 12 1 0
12 15 1 0
14 13 1 0
13 11 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
20 21 1 0
18 22 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
26 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.63Molecular Weight (Monoisotopic): 490.2151AlogP: 4.10#Rotatable Bonds: 6Polar Surface Area: 89.51Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.51CX LogP: 3.15CX LogD: 1.97Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.72
References 1. Wang Y, Li L, Fan J, Dai Y, Jiang A, Geng M, Ai J, Duan W.. (2018) Discovery of Potent Irreversible Pan-Fibroblast Growth Factor Receptor (FGFR) Inhibitors., 61 (20): [PMID:29522671 ] [10.1021/acs.jmedchem.7b01843 ]