1-(3-(4-Amino-5-(7-methoxy-5-methylbenzo[b]thiophen-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)pyrrolidin-1-yl)-2-((dimethylamino)methyl)prop-2-en-1-one

ID: ALA4557987

PubChem CID: 155554550

Max Phase: Preclinical

Molecular Formula: C26H30N6O2S

Molecular Weight: 490.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C(CN(C)C)C(=O)N1CCC(n2cc(-c3cc4cc(C)cc(OC)c4s3)c3c(N)ncnc32)C1

Standard InChI:  InChI=1S/C26H30N6O2S/c1-15-8-17-10-21(35-23(17)20(9-15)34-5)19-13-32(25-22(19)24(27)28-14-29-25)18-6-7-31(12-18)26(33)16(2)11-30(3)4/h8-10,13-14,18H,2,6-7,11-12H2,1,3-5H3,(H2,27,28,29)

Standard InChI Key:  FVECKDIACHPELI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   34.7664  -16.4016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7652  -17.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4774  -17.6383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4756  -15.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1883  -16.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1931  -17.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9773  -17.4692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4588  -16.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9695  -16.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4732  -15.1714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2175  -15.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9948  -15.1011    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.7308  -14.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2072  -14.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9882  -14.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5943  -13.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4206  -12.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6353  -12.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0326  -13.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3770  -13.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5511  -14.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4580  -11.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2385  -18.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7618  -18.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2501  -19.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0259  -19.3217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0210  -18.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7340  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7340  -20.5495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4459  -19.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4459  -18.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1577  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8696  -19.3196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.5814  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8696  -18.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  1  0
  9 11  1  0
 11 12  1  0
 12 15  1  0
 14 13  1  0
 13 11  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 16 20  1  0
 20 21  1  0
 18 22  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 26 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4557987

    ---

Associated Targets(Human)

FGFR1 Tclin Fibroblast growth factor receptor 1 (9149 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FGFR4 Tclin Fibroblast growth factor receptor 4 (3668 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1581 (382 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.63Molecular Weight (Monoisotopic): 490.2151AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 89.51Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.51CX LogP: 3.15CX LogD: 1.97
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.72

References

1. Wang Y, Li L, Fan J, Dai Y, Jiang A, Geng M, Ai J, Duan W..  (2018)  Discovery of Potent Irreversible Pan-Fibroblast Growth Factor Receptor (FGFR) Inhibitors.,  61  (20): [PMID:29522671] [10.1021/acs.jmedchem.7b01843]

Source