The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Stelleramacrin ID: ALA4558004
PubChem CID: 155554656
Max Phase: Preclinical
Molecular Formula: C37H50O11
Molecular Weight: 670.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@]12C[C@@H](COC(=O)c3ccccc3)[C@@]34OC5(O[C@@H]1[C@@H]3[C@@H]1O[C@]1(CO)[C@@H](O)[C@@]1(O)[C@H]4[C@H]([C@H](C)[C@@H]1O)[C@H](C)CCCCCC[C@H]5O)O2
Standard InChI: InChI=1S/C37H50O11/c1-19(2)33-16-23(17-44-31(41)22-13-9-7-10-14-22)36-26-29(33)46-37(47-33,48-36)24(39)15-11-6-5-8-12-20(3)25-21(4)28(40)35(43,27(25)36)32(42)34(18-38)30(26)45-34/h7,9-10,13-14,20-21,23-30,32,38-40,42-43H,1,5-6,8,11-12,15-18H2,2-4H3/t20-,21+,23+,24-,25+,26-,27-,28+,29-,30+,32-,33-,34+,35-,36-,37?/m1/s1
Standard InChI Key: DKIOSHVXYALWQK-CBTRKQJLSA-N
Molfile:
RDKit 2D
53 60 0 0 0 0 0 0 0 0999 V2000
19.2191 -12.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2179 -13.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8806 -13.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5448 -13.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5420 -12.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8788 -12.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4439 -15.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5206 -15.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8661 -15.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1858 -16.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1858 -15.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5218 -14.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8654 -16.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5218 -16.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3767 -17.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9408 -17.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1565 -16.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9230 -16.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1786 -17.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6471 -17.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1357 -17.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8800 -17.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8452 -14.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5022 -15.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8476 -14.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8578 -16.8102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0042 -18.3628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5495 -17.7264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7478 -17.7246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8389 -15.6670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8602 -15.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3154 -14.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3113 -14.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0459 -14.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4215 -13.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0860 -14.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4616 -13.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0972 -14.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5582 -16.7111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0588 -16.9670 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.7629 -13.6794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1586 -16.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1957 -15.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2069 -14.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5456 -15.2908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8822 -14.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3502 -15.5927 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.0612 -15.3657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.9173 -16.2489 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.5099 -18.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1271 -19.0638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3808 -17.3756 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.0441 -15.4151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
9 13 1 0
9 12 1 0
14 10 1 0
10 11 1 0
11 12 1 0
13 14 1 0
14 20 1 0
13 17 1 0
21 15 1 0
16 15 1 0
16 17 1 0
17 8 1 0
8 18 1 0
18 19 1 0
19 16 1 0
21 20 1 0
22 21 1 0
20 22 1 0
11 23 1 1
23 24 2 0
23 25 1 0
13 26 1 6
15 27 1 1
16 28 1 1
19 29 1 1
11 30 1 0
7 26 1 0
8 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
7 38 1 0
7 30 1 0
10 39 1 0
39 7 1 0
14 40 1 1
38 41 1 1
18 42 1 1
31 43 1 6
9 44 1 6
44 45 1 0
45 46 1 0
46 3 1 0
17 47 1 6
8 48 1 1
10 49 1 1
21 50 1 1
50 51 1 0
20 52 1 1
46 53 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 670.80Molecular Weight (Monoisotopic): 670.3353AlogP: 2.46#Rotatable Bonds: 5Polar Surface Area: 167.67Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.05CX Basic pKa: ┄CX LogP: 3.26CX LogD: 3.26Aromatic Rings: 1Heavy Atoms: 48QED Weighted: 0.18Np Likeness Score: 2.23
References 1. Liu Q, Cheng YY, Li W, Huang L, Asada Y, Hsieh MT, Morris-Natschke SL, Chen CH, Koike K, Lee KH.. (2019) Synthesis and Structure-Activity Relationship Correlations of Gnidimacrin Derivatives as Potent HIV-1 Inhibitors and HIV Latency Reversing Agents., 62 (15): [PMID:31343875 ] [10.1021/acs.jmedchem.9b00339 ]