The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((2S)-1-(((3S)-1-(benzylamino)-2-hydroxy-4-methyl-1-oxopentan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate ID: ALA4558015
PubChem CID: 155554704
Max Phase: Preclinical
Molecular Formula: C27H37N3O5
Molecular Weight: 483.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](C(C)C)C(O)C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C27H37N3O5/c1-18(2)15-22(29-27(34)35-17-21-13-9-6-10-14-21)25(32)30-23(19(3)4)24(31)26(33)28-16-20-11-7-5-8-12-20/h5-14,18-19,22-24,31H,15-17H2,1-4H3,(H,28,33)(H,29,34)(H,30,32)/t22-,23-,24?/m0/s1
Standard InChI Key: SEANKAPFNGEGOE-NTZARQNWSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
4.3000 -15.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0145 -14.7376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5856 -14.7376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -15.9751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5856 -13.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8711 -13.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8741 -12.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1605 -12.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4450 -12.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4476 -13.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1619 -13.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7282 -15.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4434 -14.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7816 -15.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1579 -15.1501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4434 -13.9126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8724 -14.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5868 -15.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3014 -14.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0159 -15.1501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3014 -13.9126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7303 -14.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4448 -15.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4431 -15.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1567 -16.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8722 -15.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8696 -15.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1553 -14.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5256 -16.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6045 -17.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1974 -15.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5868 -15.9751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8724 -13.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5869 -13.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1579 -13.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
12 14 1 6
13 15 1 0
13 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
29 30 1 0
29 31 1 0
18 32 1 0
17 33 1 1
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.61Molecular Weight (Monoisotopic): 483.2733AlogP: 3.15#Rotatable Bonds: 12Polar Surface Area: 116.76Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.47CX Basic pKa: ┄CX LogP: 3.70CX LogD: 3.70Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -0.37
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]