(4-fluorophenyl)(7-methyl-3-(quinolin-2-yl)-4,5-dihydroisoxazolo[5,4-c]pyridin-6(7H)-yl)methanone

ID: ALA4558106

PubChem CID: 145864511

Max Phase: Preclinical

Molecular Formula: C23H18FN3O2

Molecular Weight: 387.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1c2onc(-c3ccc4ccccc4n3)c2CCN1C(=O)c1ccc(F)cc1

Standard InChI:  InChI=1S/C23H18FN3O2/c1-14-22-18(12-13-27(14)23(28)16-6-9-17(24)10-7-16)21(26-29-22)20-11-8-15-4-2-3-5-19(15)25-20/h2-11,14H,12-13H2,1H3

Standard InChI Key:  KGFXBWZIVFHWJW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   15.9724   -9.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3829  -10.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3829   -9.3152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6777   -8.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0918   -8.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7983   -9.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0942   -8.0914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7944  -10.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5000  -10.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2099  -10.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2097   -9.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5034   -8.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9170  -10.5513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.0900  -10.5420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6777  -10.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9724  -10.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3698  -10.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7026  -11.4199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5108  -11.3325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5700  -10.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3191   -9.7341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2326  -10.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0310  -11.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9741  -10.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5207   -9.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2679   -8.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4689   -8.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9232   -9.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1789  -10.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 16  1  0
  1  4  1  0
 15  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  6  1  0
 10 13  1  0
  2 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 17 20  1  0
 20 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4558106

    ---

Associated Targets(Human)

TACR3 Tchem Neurokinin 3 receptor (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.41Molecular Weight (Monoisotopic): 387.1383AlogP: 4.79#Rotatable Bonds: 2
Polar Surface Area: 59.23Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.12

References

1. Yamamoto K, Inuki S, Ohno H, Oishi S..  (2019)  Scaffold hopping of fused piperidine-type NK3 receptor antagonists to reduce environmental impact.,  27  (10): [PMID:30975505] [10.1016/j.bmc.2019.03.059]

Source