The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(Bis(4-chlorophenyl)methyl)thiophene-2-carbonyl)-L-arginine ID: ALA4558167
PubChem CID: 155557328
Max Phase: Preclinical
Molecular Formula: C24H24Cl2N4O3S
Molecular Weight: 519.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)c1ccc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)s1)C(=O)O
Standard InChI: InChI=1S/C24H24Cl2N4O3S/c25-16-7-3-14(4-8-16)21(15-5-9-17(26)10-6-15)19-11-12-20(34-19)22(31)30-18(23(32)33)2-1-13-29-24(27)28/h3-12,18,21H,1-2,13H2,(H,30,31)(H,32,33)(H4,27,28,29)/t18-/m0/s1
Standard InChI Key: NUUFFQHDUAQTIN-SFHVURJKSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
20.1559 -15.4964 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8980 -15.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7942 -14.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9843 -14.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5923 -14.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6194 -15.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6388 -16.3582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3213 -15.1118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0426 -15.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7446 -15.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0621 -16.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3602 -16.7540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7835 -16.7203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7251 -14.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4229 -13.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4034 -13.0065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1053 -12.5811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0859 -11.7601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8267 -12.9728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7706 -14.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3647 -14.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3594 -15.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5379 -15.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1267 -16.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5363 -17.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3613 -17.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7688 -16.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7845 -13.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3793 -12.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5576 -12.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1429 -13.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5505 -14.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1277 -17.7338 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.1526 -12.0519 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 1
9 11 1 0
11 12 1 0
11 13 2 0
10 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
5 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 21 1 0
25 33 1 0
30 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.45Molecular Weight (Monoisotopic): 518.0946AlogP: 4.68#Rotatable Bonds: 10Polar Surface Area: 128.30Molecular Species: ZWITTERIONHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.51CX Basic pKa: 11.99CX LogP: 3.31CX LogD: 3.31Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.41
References 1. Rowley JA, Reid RC, Poon EKY, Wu KC, Lim J, Lohman RJ, Hamidon JK, Yau MK, Halili MA, Durek T, Iyer A, Fairlie DP.. (2020) Potent Thiophene Antagonists of Human Complement C3a Receptor with Anti-Inflammatory Activity., 63 (2): [PMID:31910011 ] [10.1021/acs.jmedchem.9b00927 ]