The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(7,8-Dichloro-4-cyano-3-trifluoromethyl-benzo[4,5]imidazo[1,2-a]pyridin-1-yl)-4-trifluoromethoxy-benzenesulfonamide ID: ALA4558267
PubChem CID: 155557676
Max Phase: Preclinical
Molecular Formula: C20H8Cl2F6N4O3S
Molecular Weight: 569.27
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1c(C(F)(F)F)cc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)n2c1nc1cc(Cl)c(Cl)cc12
Standard InChI: InChI=1S/C20H8Cl2F6N4O3S/c21-13-6-15-16(7-14(13)22)32-17(5-12(19(23,24)25)11(8-29)18(32)30-15)31-36(33,34)10-3-1-9(2-4-10)35-20(26,27)28/h1-7,31H
Standard InChI Key: GHNGJNBUUWVGJG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
31.4247 -6.3889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6075 -6.3889 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.0161 -7.0967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9013 -9.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6066 -8.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6066 -8.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9013 -7.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9013 -10.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9013 -10.8835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3137 -9.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3125 -10.0715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0220 -8.8467 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0190 -9.6618 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1960 -8.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1915 -8.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4203 -9.1014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9363 -8.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4152 -7.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0825 -7.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2710 -6.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7935 -7.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1288 -8.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9024 -6.7975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6118 -5.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3215 -5.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3230 -4.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6153 -3.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9047 -4.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9067 -5.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9802 -7.5408 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.9357 -6.2106 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.6153 -3.1235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3230 -2.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3231 -1.8977 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0307 -3.1235 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0273 -2.2989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
15 7 1 0
14 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
4 8 1 0
8 9 3 0
5 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
14 15 1 0
15 18 1 0
17 16 1 0
16 14 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 23 1 0
23 2 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
20 31 1 0
27 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.27Molecular Weight (Monoisotopic): 567.9598AlogP: 6.38#Rotatable Bonds: 4Polar Surface Area: 96.49Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.93CX Basic pKa: 3.75CX LogP: 6.11CX LogD: 5.64Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.66
References 1. Mayoka G, Njoroge M, Okombo J, Gibhard L, Sanches-Vaz M, Fontinha D, Birkholtz LM, Reader J, van der Watt M, Coetzer TL, Lauterbach S, Churchyard A, Bezuidenhout B, Egan TJ, Yeates C, Wittlin S, Prudêncio M, Chibale K.. (2019) Structure-Activity Relationship Studies and Plasmodium Life Cycle Profiling Identifies Pan-Active N-Aryl-3-trifluoromethyl Pyrido[1,2- a]benzimidazoles Which Are Efficacious in an in Vivo Mouse Model of Malaria., 62 (2): [PMID:30562027 ] [10.1021/acs.jmedchem.8b01769 ]