The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3,4-dimethoxybenzylidene)-3-(4-(4-(2-methoxyphenyl)piperazine-1-yl)butyl)-imidazolidine-2,4-dione ID: ALA4558286
PubChem CID: 155557720
Max Phase: Preclinical
Molecular Formula: C27H34N4O5
Molecular Weight: 494.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\NC(=O)N(CCCCN3CCN(c4ccccc4OC)CC3)C2=O)cc1OC
Standard InChI: InChI=1S/C27H34N4O5/c1-34-23-9-5-4-8-22(23)30-16-14-29(15-17-30)12-6-7-13-31-26(32)21(28-27(31)33)18-20-10-11-24(35-2)25(19-20)36-3/h4-5,8-11,18-19H,6-7,12-17H2,1-3H3,(H,28,33)/b21-18-
Standard InChI Key: QIDYVSYCHRPJFP-UZYVYHOESA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.0362 -12.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0351 -13.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7431 -13.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4528 -13.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4500 -12.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7413 -12.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3270 -13.7165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6197 -13.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3284 -12.0805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3282 -11.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1561 -12.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8691 -12.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8684 -13.2972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6461 -13.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1274 -12.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6471 -12.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9002 -11.4503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8980 -14.3280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9446 -12.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3537 -12.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1709 -12.1831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5800 -11.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3972 -11.4763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8020 -12.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6156 -12.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0285 -11.4810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6217 -10.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8019 -10.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8457 -11.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2463 -12.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0628 -12.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4754 -11.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0656 -10.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2505 -10.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8414 -10.0728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2496 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
14 18 2 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.59Molecular Weight (Monoisotopic): 494.2529AlogP: 3.21#Rotatable Bonds: 10Polar Surface Area: 83.58Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.61CX Basic pKa: 7.89CX LogP: 2.63CX LogD: 2.14Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.04
References 1. Czopek A, Bucki A, Kołaczkowski M, Zagórska A, Drop M, Pawłowski M, Siwek A, Głuch-Lutwin M, Pękala E, Chrzanowska A, Struga M, Partyka A, Wesołowska A.. (2019) Novel multitarget 5-arylidenehydantoins with arylpiperazinealkyl fragment: Pharmacological evaluation and investigation of cytotoxicity and metabolic stability., 27 (18): [PMID:31383628 ] [10.1016/j.bmc.2019.07.046 ]