2-((4-(3-(4-(2-Hydroxy-2-methylpropoxy)-3-methylphenyl)pentan-3-yl)-2-methylphenoxy)methyl)propane-1,3-diol

ID: ALA4558352

PubChem CID: 155557531

Max Phase: Preclinical

Molecular Formula: C27H40O5

Molecular Weight: 444.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(CC)(c1ccc(OCC(CO)CO)c(C)c1)c1ccc(OCC(C)(C)O)c(C)c1

Standard InChI:  InChI=1S/C27H40O5/c1-7-27(8-2,23-10-12-25(20(4)14-23)32-18-26(5,6)30)22-9-11-24(19(3)13-22)31-17-21(15-28)16-29/h9-14,21,28-30H,7-8,15-18H2,1-6H3

Standard InChI Key:  ZWPROKZMKJOXLV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   29.0031   -3.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5947   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4197   -4.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3086   -2.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9988   -2.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8708   -1.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8699   -1.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6657   -2.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1676   -2.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1664   -3.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8813   -4.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5978   -3.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5950   -2.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8796   -2.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0241   -2.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0238   -3.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7390   -4.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4531   -3.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4473   -2.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7315   -2.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8811   -5.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7418   -4.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1697   -4.1590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4516   -4.1814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7374   -3.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0224   -4.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3083   -3.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5933   -4.1791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8821   -3.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6029   -4.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0218   -5.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3070   -5.4173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13  4  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
 17 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 23 29  1  0
 29  2  1  0
  2 30  1  0
 26 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558352

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.61Molecular Weight (Monoisotopic): 444.2876AlogP: 4.54#Rotatable Bonds: 12
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.93CX LogD: 4.93
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: 0.16

References

1. Misawa T, Tsuji G, Takahashi T, Ochiai E, Takagi KI, Horie K, Kakuda S, Takimoto-Kamimura M, Kurihara M, Demizu Y..  (2018)  Structural development of non-secosteroidal vitamin D receptor (VDR) ligands without any asymmetric carbon.,  26  (23-24): [PMID:30446437] [10.1016/j.bmc.2018.11.008]

Source