The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(3-Methoxy-4-((3-methylbut-2-en-1-yl)oxy)phenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one ID: ALA4558376
PubChem CID: 155557579
Max Phase: Preclinical
Molecular Formula: C24H28O6
Molecular Weight: 412.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OCC=C(C)C
Standard InChI: InChI=1S/C24H28O6/c1-16(2)11-12-30-20-10-8-18(15-21(20)26-3)19(25)9-7-17-13-22(27-4)24(29-6)23(14-17)28-5/h7-11,13-15H,12H2,1-6H3/b9-7+
Standard InChI Key: JICBPIZUNNAECM-VQHVLOKHSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
16.6262 -27.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3339 -27.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6262 -26.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0416 -27.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7493 -27.5758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8284 -27.5495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8259 -28.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4122 -27.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7065 -27.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4585 -26.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4573 -27.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1654 -27.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8750 -27.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8722 -26.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1636 -25.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5784 -25.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2876 -26.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5753 -25.1161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9938 -25.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7030 -26.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1185 -27.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1128 -26.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4039 -25.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8175 -25.9094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5282 -26.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7507 -25.9398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7505 -25.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9185 -27.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4139 -28.3727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7070 -28.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
2 4 1 0
4 5 1 0
6 7 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 9 2 0
9 8 1 0
8 21 2 0
21 22 1 0
22 23 2 0
23 20 1 0
11 5 1 0
21 6 1 0
22 24 1 0
24 25 1 0
10 26 1 0
26 27 1 0
1 28 1 0
8 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.48Molecular Weight (Monoisotopic): 412.1886AlogP: 4.96#Rotatable Bonds: 10Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: 0.43
References 1. Espinoza-Hicks JC, Chacón-Vargas KF, Hernández-Rivera JL, Nogueda-Torres B, Tamariz J, Sánchez-Torres LE, Camacho-Dávila A.. (2019) Novel prenyloxy chalcones as potential leishmanicidal and trypanocidal agents: Design, synthesis and evaluation., 167 [PMID:30784876 ] [10.1016/j.ejmech.2019.02.028 ]