The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(2-methoxyethyl)-imidazolidin-2-one ID: ALA4558432
PubChem CID: 155557759
Max Phase: Preclinical
Molecular Formula: C26H31ClN6O5S
Molecular Weight: 575.09
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)C(C)C)n3)c(OC)c2)C1=O
Standard InChI: InChI=1S/C26H31ClN6O5S/c1-17(2)39(35,36)23-8-6-5-7-21(23)29-24-19(27)16-28-25(31-24)30-20-10-9-18(15-22(20)38-4)33-12-11-32(26(33)34)13-14-37-3/h5-10,15-17H,11-14H2,1-4H3,(H2,28,29,30,31)
Standard InChI Key: SAAUHLXTQNDEMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
25.2628 -14.5939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4456 -14.5939 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.8542 -15.3016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7425 -12.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7414 -13.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4494 -13.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1591 -13.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1563 -12.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4476 -12.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8674 -13.7774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7414 -15.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7454 -15.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0317 -14.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5745 -13.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2795 -13.7756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9861 -13.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9853 -12.5485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2719 -12.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5683 -12.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8579 -12.1486 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.6943 -13.7744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4015 -13.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1087 -13.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8155 -13.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8150 -12.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1019 -12.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3980 -12.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1085 -14.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4006 -15.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8111 -10.9134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5198 -11.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5255 -12.1351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3022 -12.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7766 -11.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2930 -11.0632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5401 -10.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3382 -10.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5853 -9.3298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3834 -9.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
7 10 1 0
2 11 1 0
11 12 1 0
11 13 1 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
28 29 1 0
25 32 1 0
31 30 2 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.09Molecular Weight (Monoisotopic): 574.1765AlogP: 4.70#Rotatable Bonds: 11Polar Surface Area: 125.99Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 2.15CX LogP: 3.56CX LogD: 3.56Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.83
References 1. Lei H, Jiang N, Miao X, Xing L, Guo M, Liu Y, Xu H, Gong P, Zuo D, Zhai X.. (2019) Discovery of novel mutant-combating ALK and ROS1 dual inhibitors bearing imidazolidin-2-one moiety with reasonable PK properties., 171 [PMID:30927566 ] [10.1016/j.ejmech.2019.03.038 ]