The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-6-fluoro-N'-(3,4,5-trimethoxybenzylidene)-1,4-dihydroindeno[1,2-c]pyrazole-3-carbohydrazide ID: ALA4558448
PubChem CID: 155557450
Max Phase: Preclinical
Molecular Formula: C21H19FN4O4
Molecular Weight: 410.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/NC(=O)c2n[nH]c3c2Cc2cc(F)ccc2-3)cc(OC)c1OC
Standard InChI: InChI=1S/C21H19FN4O4/c1-28-16-6-11(7-17(29-2)20(16)30-3)10-23-26-21(27)19-15-9-12-8-13(22)4-5-14(12)18(15)24-25-19/h4-8,10H,9H2,1-3H3,(H,24,25)(H,26,27)/b23-10+
Standard InChI Key: JMTYEIPOWYIGDY-AUEPDCJTSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
28.3376 -3.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3365 -4.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0445 -4.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7516 -4.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7513 -3.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0427 -3.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5341 -3.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0195 -3.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5346 -4.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8063 -3.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8072 -2.7601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0210 -2.5039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4669 -4.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3806 -4.8808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2138 -3.7366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8744 -4.2177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6213 -3.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2819 -4.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1923 -5.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8521 -5.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6000 -5.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6841 -4.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0233 -4.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6284 -4.6581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.4298 -4.1746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0921 -4.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2612 -5.8061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1760 -6.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7654 -6.4701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0184 -6.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
7 5 1 0
7 8 2 0
9 8 1 0
4 9 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 7 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
2 24 1 0
22 25 1 0
25 26 1 0
21 27 1 0
27 28 1 0
20 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.41Molecular Weight (Monoisotopic): 410.1390AlogP: 2.91#Rotatable Bonds: 6Polar Surface Area: 97.83Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.46CX Basic pKa: 1.51CX LogP: 3.01CX LogD: 2.02Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.27
References 1. Shareef MA, Sirisha K, Khan I, Sayeed IB, Jadav SS, Ramu G, Kumar CG, Kamal A, Babu BN.. (2019) Design, synthesis, and antimicrobial evaluation of 1,4-dihydroindeno[1,2-c ]pyrazole tethered carbohydrazide hybrids: exploring their in silico ADMET, ergosterol inhibition and ROS inducing potential., 10 (5): [PMID:31191871 ] [10.1039/C9MD00155G ]