The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cinerol I ID: ALA4558595
PubChem CID: 155557490
Max Phase: Preclinical
Molecular Formula: C26H33NO2
Molecular Weight: 391.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CCC[C@H]2[C@](C)(Cc3cc(-n4cccc4C=O)ccc3O)[C@@H](C)CC[C@]12C
Standard InChI: InChI=1S/C26H33NO2/c1-18-7-5-9-24-25(18,3)13-12-19(2)26(24,4)16-20-15-21(10-11-23(20)29)27-14-6-8-22(27)17-28/h6-8,10-11,14-15,17,19,24,29H,5,9,12-13,16H2,1-4H3/t19-,24+,25+,26+/m0/s1
Standard InChI Key: RGONUWLHZZUMNT-HCRCJJAXSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.6567 -25.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6567 -26.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3661 -26.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3661 -25.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0714 -25.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0679 -26.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7741 -26.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4883 -26.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4918 -25.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7811 -25.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7834 -24.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4964 -24.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2041 -24.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -24.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9194 -23.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0600 -27.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4880 -24.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2057 -25.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0641 -24.9408 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.3670 -27.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 -23.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2031 -22.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7868 -22.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6234 -24.5390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7095 -25.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5084 -25.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9188 -24.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3733 -24.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1019 -25.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2712 -26.6956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 22 1 0
21 12 1 0
6 16 1 1
10 17 1 1
9 18 1 1
5 19 1 6
3 20 1 0
21 22 2 0
21 23 1 0
14 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 24 1 0
25 29 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 391.56Molecular Weight (Monoisotopic): 391.2511AlogP: 6.34#Rotatable Bonds: 4Polar Surface Area: 42.23Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.53CX Basic pKa: ┄CX LogP: 6.59CX LogD: 6.59Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: 1.54
References 1. Jiao WH, Li J, Wang D, Zhang MM, Liu LY, Sun F, Li JY, Capon RJ, Lin HW.. (2019) Cinerols, Nitrogenous Meroterpenoids from the Marine Sponge Dysidea cinerea ., 82 (9): [PMID:31532203 ] [10.1021/acs.jnatprod.9b00471 ]