The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Chloro-N-(3-fluoro-4-((5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)phenyl)-1,2-dimethyl-4-oxo-1,4-dihydroquinoline-3-carboxamide ID: ALA4558601
PubChem CID: 126617902
Max Phase: Preclinical
Molecular Formula: C30H21ClFN5O3
Molecular Weight: 553.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)Nc2ccc(Oc3ncnc4[nH]cc(-c5ccccc5)c34)c(F)c2)c(=O)c2cc(Cl)ccc2n1C
Standard InChI: InChI=1S/C30H21ClFN5O3/c1-16-25(27(38)20-12-18(31)8-10-23(20)37(16)2)29(39)36-19-9-11-24(22(32)13-19)40-30-26-21(17-6-4-3-5-7-17)14-33-28(26)34-15-35-30/h3-15H,1-2H3,(H,36,39)(H,33,34,35)
Standard InChI Key: ZDMIHOSYQRRYHU-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
24.0862 -10.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7959 -9.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7931 -8.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0844 -8.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3782 -9.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3823 -8.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6823 -8.4733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9738 -8.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9698 -9.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6742 -10.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2596 -10.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6712 -10.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5544 -9.6816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2547 -10.9116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8442 -10.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1424 -9.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4327 -10.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4274 -10.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1376 -11.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8443 -10.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7178 -11.2983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7139 -12.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7060 -13.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4180 -13.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4187 -12.5224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9997 -13.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0038 -12.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2326 -12.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7519 -12.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2260 -13.5815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9826 -11.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5342 -10.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2861 -10.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4869 -9.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9361 -10.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1871 -11.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6875 -7.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2688 -8.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7277 -9.6618 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.5042 -10.1042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
10 12 2 0
11 13 1 0
11 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 27 2 0
26 23 2 0
23 24 1 0
24 25 2 0
25 22 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 31 1 0
7 37 1 0
8 38 1 0
17 39 1 0
2 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.98Molecular Weight (Monoisotopic): 553.1317AlogP: 6.62#Rotatable Bonds: 5Polar Surface Area: 101.90Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: 3.43CX LogP: 6.04CX LogD: 6.04Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.32
References 1. Tan L, Zhang Z, Gao D, Luo J, Tu ZC, Li Z, Peng L, Ren X, Ding K.. (2016) 4-Oxo-1,4-dihydroquinoline-3-carboxamide Derivatives as New Axl Kinase Inhibitors., 59 (14): [PMID:27379978 ] [10.1021/acs.jmedchem.6b00608 ]