6-Chloro-N-(3-fluoro-4-((5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)phenyl)-1,2-dimethyl-4-oxo-1,4-dihydroquinoline-3-carboxamide

ID: ALA4558601

PubChem CID: 126617902

Max Phase: Preclinical

Molecular Formula: C30H21ClFN5O3

Molecular Weight: 553.98

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)Nc2ccc(Oc3ncnc4[nH]cc(-c5ccccc5)c34)c(F)c2)c(=O)c2cc(Cl)ccc2n1C

Standard InChI:  InChI=1S/C30H21ClFN5O3/c1-16-25(27(38)20-12-18(31)8-10-23(20)37(16)2)29(39)36-19-9-11-24(22(32)13-19)40-30-26-21(17-6-4-3-5-7-17)14-33-28(26)34-15-35-30/h3-15H,1-2H3,(H,36,39)(H,33,34,35)

Standard InChI Key:  ZDMIHOSYQRRYHU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   24.0862  -10.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7959   -9.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7931   -8.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0844   -8.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3782   -9.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3823   -8.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6823   -8.4733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9738   -8.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9698   -9.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6742  -10.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2596  -10.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6712  -10.9206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5544   -9.6816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2547  -10.9116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8442  -10.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1424   -9.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4327  -10.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4274  -10.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1376  -11.3057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8443  -10.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7178  -11.2983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7139  -12.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7060  -13.7471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4180  -13.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4187  -12.5224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9997  -13.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0038  -12.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2326  -12.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7519  -12.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2260  -13.5815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9826  -11.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5342  -10.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2861  -10.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4869   -9.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9361  -10.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1871  -11.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6875   -7.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2688   -8.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7277   -9.6618    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.5042  -10.1042    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 10 12  2  0
 11 13  1  0
 11 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 27  2  0
 26 23  2  0
 23 24  1  0
 24 25  2  0
 25 22  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 28 31  1  0
  7 37  1  0
  8 38  1  0
 17 39  1  0
  2 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558601

    ---

Associated Targets(Human)

AXL Tchem Tyrosine-protein kinase receptor UFO (3469 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.98Molecular Weight (Monoisotopic): 553.1317AlogP: 6.62#Rotatable Bonds: 5
Polar Surface Area: 101.90Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.46CX Basic pKa: 3.43CX LogP: 6.04CX LogD: 6.04
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.32

References

1. Tan L, Zhang Z, Gao D, Luo J, Tu ZC, Li Z, Peng L, Ren X, Ding K..  (2016)  4-Oxo-1,4-dihydroquinoline-3-carboxamide Derivatives as New Axl Kinase Inhibitors.,  59  (14): [PMID:27379978] [10.1021/acs.jmedchem.6b00608]

Source