The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3,4-Dimethoxyphenyl)-N-(2-morpholinoethyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine ID: ALA4558621
PubChem CID: 155557567
Max Phase: Preclinical
Molecular Formula: C25H27N5O4
Molecular Weight: 461.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCN4CCOCC4)c3c2)cc1OC
Standard InChI: InChI=1S/C25H27N5O4/c1-31-22-6-4-18(14-23(22)32-2)17-3-5-21-19(13-17)24(20(15-27-21)25-29-28-16-34-25)26-7-8-30-9-11-33-12-10-30/h3-6,13-16H,7-12H2,1-2H3,(H,26,27)
Standard InChI Key: LXUUOTNZDNGCQU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
40.5569 -4.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5557 -5.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2638 -5.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2620 -4.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9706 -4.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9713 -5.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6799 -5.7335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3881 -5.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3834 -4.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6743 -4.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0877 -4.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8363 -4.4131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.3794 -3.8025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.9665 -3.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1683 -3.2721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6700 -3.2800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9601 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9558 -2.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2459 -1.6532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2463 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5405 -0.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8325 -0.8416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8349 -1.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5452 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8511 -4.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8523 -3.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1453 -2.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4367 -3.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4395 -4.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1471 -4.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7284 -2.8775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7271 -2.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7334 -4.5176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7364 -5.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
9 11 1 0
10 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
1 25 1 0
28 31 1 0
31 32 1 0
29 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.52Molecular Weight (Monoisotopic): 461.2063AlogP: 3.71#Rotatable Bonds: 8Polar Surface Area: 94.77Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.14CX LogP: 1.74CX LogD: 1.54Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.28
References 1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A.. (2019) Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity., 62 (7): [PMID:30897325 ] [10.1021/acs.jmedchem.8b01938 ]