6-(3,4-Dimethoxyphenyl)-N-(2-morpholinoethyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine

ID: ALA4558621

PubChem CID: 155557567

Max Phase: Preclinical

Molecular Formula: C25H27N5O4

Molecular Weight: 461.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCN4CCOCC4)c3c2)cc1OC

Standard InChI:  InChI=1S/C25H27N5O4/c1-31-22-6-4-18(14-23(22)32-2)17-3-5-21-19(13-17)24(20(15-27-21)25-29-28-16-34-25)26-7-8-30-9-11-33-12-10-30/h3-6,13-16H,7-12H2,1-2H3,(H,26,27)

Standard InChI Key:  LXUUOTNZDNGCQU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   40.5569   -4.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5557   -5.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2638   -5.7395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2620   -4.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9706   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9713   -5.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6799   -5.7335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.3881   -5.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3834   -4.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6743   -4.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0877   -4.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8363   -4.4131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3794   -3.8025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.9665   -3.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1683   -3.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6700   -3.2800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.9601   -2.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9558   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2459   -1.6532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2463   -0.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5405   -0.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8325   -0.8416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8349   -1.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5452   -2.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8511   -4.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8523   -3.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1453   -2.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4367   -3.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4395   -4.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1471   -4.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7284   -2.8775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7271   -2.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7334   -4.5176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7364   -5.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 10 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  1 25  1  0
 28 31  1  0
 31 32  1  0
 29 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558621

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.52Molecular Weight (Monoisotopic): 461.2063AlogP: 3.71#Rotatable Bonds: 8
Polar Surface Area: 94.77Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.14CX LogP: 1.74CX LogD: 1.54
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.28

References

1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A..  (2019)  Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity.,  62  (7): [PMID:30897325] [10.1021/acs.jmedchem.8b01938]

Source