The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1,2-Dihydro-1-(4'-fluorobenzyl)-5-(4'-methoxyphenyl)-6-methyl-2-oxopyridin-3-yl]cycloheptanecarboxamide ID: ALA4558692
PubChem CID: 155557733
Max Phase: Preclinical
Molecular Formula: C28H31FN2O3
Molecular Weight: 462.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(NC(=O)C3CCCCCC3)c(=O)n(Cc3ccc(F)cc3)c2C)cc1
Standard InChI: InChI=1S/C28H31FN2O3/c1-19-25(21-11-15-24(34-2)16-12-21)17-26(30-27(32)22-7-5-3-4-6-8-22)28(33)31(19)18-20-9-13-23(29)14-10-20/h9-17,22H,3-8,18H2,1-2H3,(H,30,32)
Standard InChI Key: DBSNIBNZUKKXHE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
30.2237 -12.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2237 -13.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9290 -13.6075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6343 -13.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6343 -12.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9290 -11.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3414 -13.6126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3432 -11.9793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0497 -12.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7586 -11.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0473 -13.2071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7003 -11.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3012 -10.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4337 -12.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1084 -10.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2161 -12.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5134 -11.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9290 -14.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6367 -14.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6325 -15.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3393 -16.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0480 -15.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0454 -14.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3379 -14.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7563 -16.0590 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.5166 -13.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5148 -11.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5161 -11.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8081 -10.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1006 -11.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1056 -11.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8142 -12.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3911 -10.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6852 -11.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
4 7 2 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
10 14 1 0
13 15 1 0
14 16 1 0
15 17 1 0
16 17 1 0
3 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
2 26 1 0
1 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.57Molecular Weight (Monoisotopic): 462.2319AlogP: 5.93#Rotatable Bonds: 6Polar Surface Area: 60.33Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.72CX Basic pKa: ┄CX LogP: 5.16CX LogD: 5.16Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.21
References 1. Gado F, Di Cesare Mannelli L, Lucarini E, Bertini S, Cappelli E, Digiacomo M, Stevenson LA, Macchia M, Tuccinardi T, Ghelardini C, Pertwee RG, Manera C.. (2018) Identification of the First Synthetic Allosteric Modulator of the CB2 Receptors and Evidence of Its Efficacy for Neuropathic Pain Relief., 62 (1): [PMID:29990428 ] [10.1021/acs.jmedchem.8b00368 ]