The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Fluorophenethyl)-2-imino-10-methyl-5-oxo-1-(2-(thiophen-2-yl)ethyl)-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide ID: ALA4558695
PubChem CID: 155557750
Max Phase: Preclinical
Molecular Formula: C27H24FN5O2S
Molecular Weight: 501.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccn2c(=O)c3cc(C(=O)NCCc4ccc(F)cc4)c(=N)n(CCc4cccs4)c3nc12
Standard InChI: InChI=1S/C27H24FN5O2S/c1-17-4-2-13-33-24(17)31-25-22(27(33)35)16-21(23(29)32(25)14-11-20-5-3-15-36-20)26(34)30-12-10-18-6-8-19(28)9-7-18/h2-9,13,15-16,29H,10-12,14H2,1H3,(H,30,34)
Standard InChI Key: VRVYFHQPZZXJKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
27.0416 -14.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0416 -15.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7510 -15.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7510 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4604 -14.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4615 -15.0066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1658 -15.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1637 -13.7735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8767 -14.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8769 -15.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5867 -15.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3007 -15.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3004 -14.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5861 -13.7714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7510 -12.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1650 -16.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0125 -13.7748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0121 -15.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0113 -16.2410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7244 -15.0077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4358 -15.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1481 -15.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8554 -15.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5847 -12.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2958 -12.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2944 -11.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9553 -11.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7001 -10.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8788 -10.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6265 -11.2328 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.8473 -16.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5537 -16.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2664 -16.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2682 -15.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5612 -15.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9725 -16.6586 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 2 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
4 15 1 0
7 16 2 0
13 17 2 0
12 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
23 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 23 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.59Molecular Weight (Monoisotopic): 501.1635AlogP: 3.85#Rotatable Bonds: 7Polar Surface Area: 92.25Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.30CX LogP: 3.91CX LogD: 3.66Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.93
References 1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG.. (2020) Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer., 63 (9): [PMID:32297747 ] [10.1021/acs.jmedchem.0c00161 ]