N-(4-Fluorophenethyl)-2-imino-10-methyl-5-oxo-1-(2-(thiophen-2-yl)ethyl)-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4558695

PubChem CID: 155557750

Max Phase: Preclinical

Molecular Formula: C27H24FN5O2S

Molecular Weight: 501.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCc4ccc(F)cc4)c(=N)n(CCc4cccs4)c3nc12

Standard InChI:  InChI=1S/C27H24FN5O2S/c1-17-4-2-13-33-24(17)31-25-22(27(33)35)16-21(23(29)32(25)14-11-20-5-3-15-36-20)26(34)30-12-10-18-6-8-19(28)9-7-18/h2-9,13,15-16,29H,10-12,14H2,1H3,(H,30,34)

Standard InChI Key:  VRVYFHQPZZXJKC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   27.0416  -14.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0416  -15.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7510  -15.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7510  -13.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4604  -14.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4615  -15.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1658  -15.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1637  -13.7735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8767  -14.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8769  -15.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5867  -15.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3007  -15.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3004  -14.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5861  -13.7714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7510  -12.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1650  -16.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0125  -13.7748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0121  -15.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0113  -16.2410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7244  -15.0077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4358  -15.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1481  -15.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8554  -15.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5847  -12.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2958  -12.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2944  -11.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9553  -11.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7001  -10.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8788  -10.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6265  -11.2328    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.8473  -16.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5537  -16.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2664  -16.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2682  -15.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5612  -15.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9725  -16.6586    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 23 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 23  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558695

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.59Molecular Weight (Monoisotopic): 501.1635AlogP: 3.85#Rotatable Bonds: 7
Polar Surface Area: 92.25Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.30CX LogP: 3.91CX LogD: 3.66
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.93

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source