1-(5-((7-chloro-4-oxo-4H-pyrido[1,2-a]pyrimidin-2-yl)methylthio)-1,3,4-thiadiazol-2-yl)-3-(3,4-dimethylphenyl)urea

ID: ALA4558719

PubChem CID: 50802411

Max Phase: Preclinical

Molecular Formula: C20H17ClN6O2S2

Molecular Weight: 472.98

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)Nc2nnc(SCc3cc(=O)n4cc(Cl)ccc4n3)s2)cc1C

Standard InChI:  InChI=1S/C20H17ClN6O2S2/c1-11-3-5-14(7-12(11)2)23-18(29)24-19-25-26-20(31-19)30-10-15-8-17(28)27-9-13(21)4-6-16(27)22-15/h3-9H,10H2,1-2H3,(H2,23,24,25,29)

Standard InChI Key:  XCECKKMYMWJNJN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   36.6195   -7.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6183   -8.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3264   -8.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   -8.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0332   -7.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3246   -6.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7444   -8.4079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4515   -7.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1598   -8.4057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4502   -7.1810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8669   -7.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6114   -8.3242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1572   -7.7161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7475   -7.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9485   -7.1802    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.0786   -6.2618    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.8912   -6.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2224   -5.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0358   -5.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3670   -4.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7415   -4.7747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.0689   -4.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8829   -3.9418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.2134   -3.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7310   -2.5339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9143   -2.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5875   -3.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1794   -4.5113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0604   -1.7861    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.9103   -8.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9117   -6.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 23  1  0
 22 21  2  0
 21 18  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 28  2  0
 25 29  1  0
  2 30  1  0
  1 31  1  0
M  END

Associated Targets(Human)

NTRK2 Tclin Neurotrophic tyrosine kinase receptor type 2 (3279 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NTRK1 Tclin Nerve growth factor receptor Trk-A (7922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.98Molecular Weight (Monoisotopic): 472.0543AlogP: 4.75#Rotatable Bonds: 5
Polar Surface Area: 101.28Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.37CX Basic pKa: 0.56CX LogP: 4.38CX LogD: 3.50
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -3.11

References

1. Subramanian G, Zhu Y, Bowen SJ, Roush N, White JA, Huczek D, Zachary T, Javens C, Williams T, Janssen A, Gonzales A..  (2019)  Lead identification and characterization of hTrkA type 2 inhibitors.,  29  (22): [PMID:31610943] [10.1016/j.bmcl.2019.126680]

Source