The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(5-Benzhydryl-1H-tetrazol-1-yl)propyl)-4-(3-flurophenyl)piperazine ID: ALA4558778
PubChem CID: 155557651
Max Phase: Preclinical
Molecular Formula: C27H29FN6
Molecular Weight: 456.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cccc(N2CCN(CCCn3nnnc3C(c3ccccc3)c3ccccc3)CC2)c1
Standard InChI: InChI=1S/C27H29FN6/c28-24-13-7-14-25(21-24)33-19-17-32(18-20-33)15-8-16-34-27(29-30-31-34)26(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-7,9-14,21,26H,8,15-20H2
Standard InChI Key: MRUQKJACXWGSTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
5.7015 -18.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3755 -18.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1460 -17.6485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3265 -17.6259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0559 -18.3961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1452 -18.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7677 -18.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6782 -19.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9592 -20.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3740 -20.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3477 -20.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0427 -21.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7627 -20.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7835 -20.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0879 -19.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2663 -19.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5477 -20.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5240 -20.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2247 -21.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9404 -20.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5375 -18.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1600 -17.9232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9263 -18.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5474 -17.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4043 -16.8686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6343 -16.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0074 -17.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -16.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7953 -16.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4195 -16.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2757 -15.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5021 -15.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8812 -15.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1881 -16.3714 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
2 6 1 0
6 7 1 0
1 8 1 0
8 9 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 9 1 0
7 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 28 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.57Molecular Weight (Monoisotopic): 456.2438AlogP: 4.20#Rotatable Bonds: 8Polar Surface Area: 50.08Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.79CX LogP: 4.95CX LogD: 4.41Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.87
References 1. Paudel S, Acharya S, Yoon G, Kim KM, Cheon SH.. (2016) Exploration of substituted arylpiperazine-tetrazoles as promising dual norepinephrine and dopamine reuptake inhibitors., 24 (21): [PMID:27647372 ] [10.1016/j.bmc.2016.09.005 ]