1-(3-(5-Benzhydryl-1H-tetrazol-1-yl)propyl)-4-(3-flurophenyl)piperazine

ID: ALA4558778

PubChem CID: 155557651

Max Phase: Preclinical

Molecular Formula: C27H29FN6

Molecular Weight: 456.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1cccc(N2CCN(CCCn3nnnc3C(c3ccccc3)c3ccccc3)CC2)c1

Standard InChI:  InChI=1S/C27H29FN6/c28-24-13-7-14-25(21-24)33-19-17-32(18-20-33)15-8-16-34-27(29-30-31-34)26(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-7,9-14,21,26H,8,15-20H2

Standard InChI Key:  MRUQKJACXWGSTF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    5.7015  -18.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3755  -18.4330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1460  -17.6485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3265  -17.6259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0559  -18.3961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1452  -18.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7677  -18.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6782  -19.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9592  -20.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3740  -20.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3477  -20.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0427  -21.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7627  -20.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7835  -20.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0879  -19.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2663  -19.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5477  -20.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5240  -20.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2247  -21.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9404  -20.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5375  -18.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1600  -17.9232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9263  -18.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5474  -17.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4043  -16.8686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6343  -16.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0074  -17.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0261  -16.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7953  -16.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4195  -16.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2757  -15.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5021  -15.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8812  -15.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1881  -16.3714    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  1  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  9  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 25 28  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558778

    ---

Associated Targets(Human)

SLC6A3 Tclin Dopamine transporter (10535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A2 Tclin Norepinephrine transporter (10102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.57Molecular Weight (Monoisotopic): 456.2438AlogP: 4.20#Rotatable Bonds: 8
Polar Surface Area: 50.08Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.79CX LogP: 4.95CX LogD: 4.41
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.87

References

1. Paudel S, Acharya S, Yoon G, Kim KM, Cheon SH..  (2016)  Exploration of substituted arylpiperazine-tetrazoles as promising dual norepinephrine and dopamine reuptake inhibitors.,  24  (21): [PMID:27647372] [10.1016/j.bmc.2016.09.005]

Source