1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(4,6-dimethoxy-1H-indol-2-yl)ethane-1,2-dione

ID: ALA4558838

PubChem CID: 155557521

Max Phase: Preclinical

Molecular Formula: C24H25N3O5

Molecular Weight: 435.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c2cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3C)[nH]c2c1

Standard InChI:  InChI=1S/C24H25N3O5/c1-15-14-26(23(29)16-7-5-4-6-8-16)9-10-27(15)24(30)22(28)20-13-18-19(25-20)11-17(31-2)12-21(18)32-3/h4-8,11-13,15,25H,9-10,14H2,1-3H3

Standard InChI Key:  HYXRLRJJRUFSHQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    7.8706  -16.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8706  -16.9134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5759  -17.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2812  -16.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2812  -16.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5759  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9901  -15.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6966  -16.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9925  -14.8725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6926  -16.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3983  -17.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1082  -16.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1080  -16.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4017  -15.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1635  -17.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4552  -16.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1647  -18.1402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4540  -16.0982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7481  -17.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0028  -16.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6655  -18.1423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8665  -18.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592  -17.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6452  -17.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2374  -18.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6497  -19.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4624  -19.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5759  -18.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2364  -16.8991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6449  -16.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2441  -19.7303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4269  -19.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  8  1  0
  2 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 16 19  1  0
 19 20  2  0
 20 23  1  0
 22 21  1  0
 21 19  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  3 28  1  0
 24 29  1  0
 29 30  1  0
 26 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558838

    ---

Associated Targets(Human)

MT2 (2907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.48Molecular Weight (Monoisotopic): 435.1794AlogP: 2.74#Rotatable Bonds: 5
Polar Surface Area: 91.94Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.56CX Basic pKa: CX LogP: 2.18CX LogD: 2.18
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.90

References

1. Wang T, Wallace OB, Zhang Z, Fang H, Yang Z, Robinson BA, Spicer TP, Gong YF, Blair WS, Shi PY, Lin PF, Deshpande M, Meanwell NA, Kadow JF..  (2019)  A survey of core replacements in indole-based HIV-1 attachment inhibitors.,  29  (11): [PMID:30940396] [10.1016/j.bmcl.2019.03.018]

Source