The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-ethyl-N4-(7-methoxy-2-phenylquinolin-4-yl)-N1-methylpentane-1,4-diamine ID: ALA4558936
PubChem CID: 155557525
Max Phase: Preclinical
Molecular Formula: C24H31N3O
Molecular Weight: 377.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C)CCCC(C)Nc1cc(-c2ccccc2)nc2cc(OC)ccc12
Standard InChI: InChI=1S/C24H31N3O/c1-5-27(3)15-9-10-18(2)25-24-17-22(19-11-7-6-8-12-19)26-23-16-20(28-4)13-14-21(23)24/h6-8,11-14,16-18H,5,9-10,15H2,1-4H3,(H,25,26)
Standard InChI Key: KYOJRCULYWQRQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
3.1229 -6.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1217 -7.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8298 -7.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8280 -5.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5366 -6.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5374 -7.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2459 -7.4504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9542 -7.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9494 -6.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2403 -5.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6635 -7.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6618 -8.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3702 -8.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0773 -8.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0715 -7.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3625 -7.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4137 -7.4555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7063 -7.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2360 -4.9969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9415 -4.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6514 -4.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9372 -3.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6427 -3.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6384 -2.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3439 -2.1255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3396 -1.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0538 -2.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0581 -3.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
2 17 1 0
17 18 1 0
10 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 377.53Molecular Weight (Monoisotopic): 377.2467AlogP: 5.44#Rotatable Bonds: 9Polar Surface Area: 37.39Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.06CX LogP: 4.85CX LogD: 1.67Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -0.99
References 1. Hussein B, Ikhmais B, Kadirvel M, Magwaza RN, Halbert G, Bryce RA, Stratford IJ, Freeman S.. (2019) Discovery of potent 4-aminoquinoline hydrazone inhibitors of NRH:quinoneoxidoreductase-2 (NQO2)., 182 [PMID:31514018 ] [10.1016/j.ejmech.2019.111649 ]