3-(4-(tert-butoxy(carboxy)methyl)-3-(chroman-6-yl)isoquinolin-1-yl)benzoic acid

ID: ALA4558950

PubChem CID: 145999098

Max Phase: Preclinical

Molecular Formula: C31H29NO6

Molecular Weight: 511.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(C(=O)O)c1c(-c2ccc3c(c2)CCCO3)nc(-c2cccc(C(=O)O)c2)c2ccccc12

Standard InChI:  InChI=1S/C31H29NO6/c1-31(2,3)38-28(30(35)36)25-22-11-4-5-12-23(22)26(19-8-6-9-21(17-19)29(33)34)32-27(25)20-13-14-24-18(16-20)10-7-15-37-24/h4-6,8-9,11-14,16-17,28H,7,10,15H2,1-3H3,(H,33,34)(H,35,36)

Standard InChI Key:  VYJNQWGNWWUIMR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   15.3519  -20.5371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3507  -21.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7656  -20.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0570  -20.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7684  -21.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0580  -21.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0564  -22.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7646  -22.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4758  -22.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4739  -21.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4718  -20.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1810  -20.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4687  -19.3050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1749  -18.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1718  -18.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8841  -19.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8779  -18.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1841  -21.3453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8872  -20.1169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6457  -21.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9377  -21.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2305  -21.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2301  -22.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9428  -22.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6471  -22.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0517  -19.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7598  -18.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7578  -18.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3450  -18.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3395  -18.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0440  -17.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0362  -16.8659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3256  -16.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6211  -16.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6272  -17.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9475  -23.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2413  -24.2200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6567  -24.2149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 12 18  2  0
 12 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  2 20  1  0
 26 27  2  0
 27 28  1  0
 28 31  2  0
 30 29  2  0
 29 26  1  0
  4 26  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 36 37  1  0
 36 38  2  0
 24 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4558950

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.57Molecular Weight (Monoisotopic): 511.1995AlogP: 6.53#Rotatable Bonds: 6
Polar Surface Area: 105.95Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.32CX Basic pKa: 3.85CX LogP: 5.49CX LogD: -0.02
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -0.32

References

1. Wilson TA, Koneru PC, Rebensburg SV, Lindenberger JJ, Kobe MJ, Cockroft NT, Adu-Ampratwum D, Larue RC, Kvaratskhelia M, Fuchs JR..  (2019)  An Isoquinoline Scaffold as a Novel Class of Allosteric HIV-1 Integrase Inhibitors.,  10  (2): [PMID:30783506] [10.1021/acsmedchemlett.8b00633]

Source