The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(6-methoxyquinolin-2-yl)ethane-1,2-dione ID: ALA4559077
PubChem CID: 5280289
Max Phase: Preclinical
Molecular Formula: C24H23N3O4
Molecular Weight: 417.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3C)ccc2c1
Standard InChI: InChI=1S/C24H23N3O4/c1-16-15-26(23(29)17-6-4-3-5-7-17)12-13-27(16)24(30)22(28)21-10-8-18-14-19(31-2)9-11-20(18)25-21/h3-11,14,16H,12-13,15H2,1-2H3
Standard InChI Key: MWOOYFPOFNSWFP-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
34.1487 -21.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1487 -21.9940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8540 -22.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5593 -21.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5593 -21.1768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8540 -20.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2682 -20.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9747 -21.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9707 -21.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6764 -22.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3862 -22.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3860 -21.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6798 -20.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2705 -19.9531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4416 -22.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7333 -21.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4428 -23.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7321 -21.1789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0262 -22.4057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3204 -21.9977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3278 -23.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0315 -23.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6145 -23.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6143 -22.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9084 -22.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2022 -22.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2063 -23.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9128 -23.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8540 -23.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5008 -23.6430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7909 -23.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
2 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
16 19 1 0
19 20 2 0
20 24 1 0
23 21 1 0
21 22 2 0
22 19 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
3 29 1 0
27 30 1 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1689AlogP: 2.80#Rotatable Bonds: 4Polar Surface Area: 79.81Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.24CX LogP: 2.86CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.17
References 1. Wang T, Wallace OB, Zhang Z, Fang H, Yang Z, Robinson BA, Spicer TP, Gong YF, Blair WS, Shi PY, Lin PF, Deshpande M, Meanwell NA, Kadow JF.. (2019) A survey of core replacements in indole-based HIV-1 attachment inhibitors., 29 (11): [PMID:30940396 ] [10.1016/j.bmcl.2019.03.018 ]