The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(Quinolin-3-yl)-1-(3-(trifluoromethyl)phenyl)oxazolo[5,4-c]quinolin-2(1H)-one ID: ALA4559116
PubChem CID: 155249671
Max Phase: Preclinical
Molecular Formula: C26H14F3N3O2
Molecular Weight: 457.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1oc2cnc3ccc(-c4cnc5ccccc5c4)cc3c2n1-c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C26H14F3N3O2/c27-26(28,29)18-5-3-6-19(12-18)32-24-20-11-15(8-9-22(20)31-14-23(24)34-25(32)33)17-10-16-4-1-2-7-21(16)30-13-17/h1-14H
Standard InChI Key: OUITYFMWWXMVNE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
30.5979 -14.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5967 -15.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3048 -15.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3030 -14.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0116 -14.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0123 -15.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7209 -15.8081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4291 -15.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7141 -14.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4210 -14.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0260 -14.0272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6930 -13.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8823 -13.3696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1003 -12.5744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3368 -12.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5896 -11.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0425 -11.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2425 -11.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9925 -12.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5413 -12.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2940 -10.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0931 -10.4333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.7464 -9.9976 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6959 -9.8930 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.8921 -14.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8933 -13.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1863 -12.9507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1881 -14.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4805 -14.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4801 -13.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7709 -12.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0617 -13.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0661 -14.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7759 -14.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
12 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
17 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
25 26 2 0
26 27 1 0
27 30 2 0
29 28 2 0
28 25 1 0
1 25 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.41Molecular Weight (Monoisotopic): 457.1038AlogP: 6.37#Rotatable Bonds: 2Polar Surface Area: 60.92Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.06CX LogP: 5.69CX LogD: 5.69Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.18
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]