The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyano-4-[(spiro[2.5]oct-6-ylmethyl)-amino]-pyrimidine-5-carboxylic acid ((R)-1-benzyl-2-pyrrolidin-1-yl-ethyl)-amide ID: ALA455912
PubChem CID: 25071954
Max Phase: Preclinical
Molecular Formula: C28H36N6O
Molecular Weight: 472.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ncc(C(=O)N[C@H](Cc2ccccc2)CN2CCCC2)c(NCC2CCC3(CC2)CC3)n1
Standard InChI: InChI=1S/C28H36N6O/c29-17-25-30-19-24(26(33-25)31-18-22-8-10-28(11-9-22)12-13-28)27(35)32-23(20-34-14-4-5-15-34)16-21-6-2-1-3-7-21/h1-3,6-7,19,22-23H,4-5,8-16,18,20H2,(H,32,35)(H,30,31,33)/t23-/m1/s1
Standard InChI Key: ZFWPNYQSYFERIU-HSZRJFAPSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
8.9170 -26.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5003 -26.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3257 -26.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3554 -24.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0705 -25.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7807 -24.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4935 -25.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7851 -26.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0660 -26.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3543 -24.0043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9284 -22.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6436 -22.7693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3574 -22.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0725 -22.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3561 -21.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0694 -23.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7836 -24.0040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4984 -23.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4945 -22.7611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7796 -22.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2141 -24.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9309 -24.4129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9271 -21.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2146 -22.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2120 -21.1216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1237 -20.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3164 -20.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9050 -20.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4581 -21.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2159 -23.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5008 -24.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5017 -24.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2174 -25.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -24.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9291 -24.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 2 1 0
17 18 2 0
2 8 1 0
18 19 1 0
8 9 1 0
19 20 2 0
20 14 1 0
16 10 1 0
4 5 1 0
18 21 1 0
4 10 1 0
21 22 3 0
5 6 1 0
11 23 1 6
2 1 1 0
11 24 1 0
11 12 1 0
23 25 1 0
25 26 1 0
3 2 1 0
12 13 1 0
1 3 1 0
13 14 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
24 30 1 0
13 15 2 0
30 31 2 0
5 9 1 0
31 32 1 0
14 16 2 0
32 33 2 0
6 7 1 0
33 34 1 0
16 17 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.64Molecular Weight (Monoisotopic): 472.2951AlogP: 4.17#Rotatable Bonds: 9Polar Surface Area: 93.94Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.28CX Basic pKa: 8.40CX LogP: 5.09CX LogD: 4.05Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -0.59
References 1. Irie O, Yokokawa F, Ehara T, Iwasaki A, Iwaki Y, Hitomi Y, Konishi K, Kishida M, Toyao A, Masuya K, Gunji H, Sakaki J, Iwasaki G, Hirao H, Kanazawa T, Tanabe K, Kosaka T, Hart TW, Hallett A.. (2008) 4-Amino-2-cyanopyrimidines: novel scaffold for nonpeptidic cathepsin S inhibitors., 18 (16): [PMID:18662880 ] [10.1016/j.bmcl.2008.07.011 ]