The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-[4-[2-(Difluoromethyl)-4-methoxy-1H-benzimidazol-1-yl]-6-(4-morpholinyl)-1,3,5-triazin-2-yl]-4-piperidinyl]-2-(dimethylamino)ethanesulfonamide ID: ALA4559189
PubChem CID: 67543767
Max Phase: Preclinical
Molecular Formula: C25H35F2N9O4S
Molecular Weight: 595.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N2CCC(NS(=O)(=O)CCN(C)C)CC2)n1
Standard InChI: InChI=1S/C25H35F2N9O4S/c1-33(2)13-16-41(37,38)32-17-7-9-34(10-8-17)23-29-24(35-11-14-40-15-12-35)31-25(30-23)36-18-5-4-6-19(39-3)20(18)28-22(36)21(26)27/h4-6,17,21,32H,7-16H2,1-3H3
Standard InChI Key: BODQTXFQNKKGON-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
42.5146 -6.0712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9273 -6.7810 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.3357 -6.0687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.2174 -7.1855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9773 -4.7339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9762 -5.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6842 -5.9624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3939 -5.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3911 -4.7303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6825 -4.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2682 -5.9615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5645 -5.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8586 -5.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8537 -6.7700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5609 -7.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2730 -6.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6800 -3.5078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3330 -3.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0790 -2.2482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0117 -3.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2615 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7160 -1.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9205 -1.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6734 -2.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2206 -3.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0295 -3.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0076 -4.2691 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.7479 -3.0627 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.9659 -0.8740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7647 -0.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1022 -5.9604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0993 -6.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8036 -7.1852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5130 -6.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5137 -5.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8049 -5.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6331 -7.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3440 -6.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0484 -7.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.7594 -6.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0419 -8.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
6 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
10 17 1 0
17 18 1 0
18 19 2 0
19 21 1 0
20 17 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
18 26 1 0
26 27 1 0
26 28 1 0
22 29 1 0
29 30 1 0
8 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
34 4 1 0
4 2 1 0
2 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.68Molecular Weight (Monoisotopic): 595.2501AlogP: 1.44#Rotatable Bonds: 10Polar Surface Area: 130.84Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.86CX Basic pKa: 7.20CX LogP: 2.13CX LogD: 1.91Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.37Np Likeness Score: -1.34
References 1. Giddens AC, Gamage SA, Kendall JD, Lee WJ, Baguley BC, Buchanan CM, Jamieson SMF, Dickson JMJ, Shepherd PR, Denny WA, Rewcastle GW.. (2019) Synthesis and biological evaluation of solubilized sulfonamide analogues of the phosphatidylinositol 3-kinase inhibitor ZSTK474., 27 (8): [PMID:30850264 ] [10.1016/j.bmc.2019.02.050 ]