2-(4-(4-(3-methoxypyridin-2-yl)piperidin-1-yl)azepan-1-yl)-4-methylthiazole

ID: ALA4559190

PubChem CID: 155557847

Max Phase: Preclinical

Molecular Formula: C21H30N4OS

Molecular Weight: 386.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccnc1C1CCN(C2CCCN(c3nc(C)cs3)CC2)CC1

Standard InChI:  InChI=1S/C21H30N4OS/c1-16-15-27-21(23-16)25-11-4-5-18(9-14-25)24-12-7-17(8-13-24)20-19(26-2)6-3-10-22-20/h3,6,10,15,17-18H,4-5,7-9,11-14H2,1-2H3

Standard InChI Key:  RPDZPTKQBNFHOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    3.5246  -18.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3400  -18.1830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7469  -17.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3395  -16.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5210  -16.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1178  -17.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5653  -17.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9725  -18.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7861  -18.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1987  -17.4789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7915  -16.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9717  -16.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7470  -16.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5642  -16.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0158  -17.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3760  -16.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1749  -16.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3726  -18.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8138  -17.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1703  -18.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8095  -17.8955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5121  -18.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6021  -19.1058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3953  -19.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8000  -18.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2568  -17.9691    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.7285  -20.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3  7  1  0
  4 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 17 19  1  0
 18 20  1  0
 19 21  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559190

    ---

Associated Targets(Human)

CHRM4 Tclin Muscarinic acetylcholine receptor M4 (6041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.57Molecular Weight (Monoisotopic): 386.2140AlogP: 4.09#Rotatable Bonds: 4
Polar Surface Area: 41.49Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.00CX LogP: 3.13CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.79Np Likeness Score: -1.62

References

1. Yang Q, Lachapelle EA, Kablaoui NM, Webb D, Popiolek M, Grimwood S, Kozak R, O'Connor RE, Lazzaro JT, Butler CR, Zhang L..  (2019)  Discovery of Selective M4 Muscarinic Acetylcholine Receptor Agonists with Novel Carbamate Isosteres.,  10  (6): [PMID:31223452] [10.1021/acsmedchemlett.9b00106]

Source