The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-5-(2-oxo-1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-imidazo[4,5-c]pyridin-6-yl)benzoic acid ID: ALA4559208
PubChem CID: 155557903
Max Phase: Preclinical
Molecular Formula: C23H21N3O7
Molecular Weight: 451.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc3c(cn2)[nH]c(=O)n3-c2cc(OC)c(OC)c(OC)c2)cc1C(=O)O
Standard InChI: InChI=1S/C23H21N3O7/c1-30-18-6-5-12(7-14(18)22(27)28)15-10-17-16(11-24-15)25-23(29)26(17)13-8-19(31-2)21(33-4)20(9-13)32-3/h5-11H,1-4H3,(H,25,29)(H,27,28)
Standard InChI Key: STXYOEIVNORTMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
41.6228 -3.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3325 -3.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3297 -2.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6210 -1.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9148 -3.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9115 -2.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1339 -1.9412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6566 -2.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1393 -3.2623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8394 -2.6071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8899 -4.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0895 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8401 -4.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3896 -5.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1918 -5.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4376 -4.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7432 -6.0209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4966 -6.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1413 -6.3729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3429 -6.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0414 -5.1611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4924 -4.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0373 -3.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0373 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7448 -4.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4528 -4.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4489 -3.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7408 -3.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1617 -4.6357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1641 -5.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1545 -2.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8643 -3.4005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1504 -2.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
17 18 1 0
14 19 1 0
19 20 1 0
13 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
2 23 1 0
26 29 1 0
29 30 1 0
27 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.44Molecular Weight (Monoisotopic): 451.1380AlogP: 3.11#Rotatable Bonds: 7Polar Surface Area: 124.90Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.68CX Basic pKa: 2.78CX LogP: 2.10CX LogD: -0.65Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -0.55
References 1. Gao F, Liang Y, Zhou P, Cheng J, Ding K, Wang Y.. (2019) Design, synthesis, antitumor activities and biological studies of novel diaryl substituted fused heterocycles as dual ligands targeting tubulin and katanin., 178 [PMID:31185410 ] [10.1016/j.ejmech.2019.05.072 ]