4-(1-(1-((4-Fluorophenyl)sulfonyl)piperidin-4-yl)-1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidine

ID: ALA4559234

PubChem CID: 155558025

Max Phase: Preclinical

Molecular Formula: C20H19FN6O2S

Molecular Weight: 426.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccc(F)cc1)N1CCC(n2cc(-c3ncnc4[nH]ccc34)cn2)CC1

Standard InChI:  InChI=1S/C20H19FN6O2S/c21-15-1-3-17(4-2-15)30(28,29)26-9-6-16(7-10-26)27-12-14(11-25-27)19-18-5-8-22-20(18)24-13-23-19/h1-5,8,11-13,16H,6-7,9-10H2,(H,22,23,24)

Standard InChI Key:  LECYELNKCQXTQQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   33.0737  -23.6103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6650  -22.8972    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.2517  -23.6077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5254  -21.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5254  -22.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2381  -22.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9508  -22.4843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9508  -21.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2381  -21.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3812  -22.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8067  -21.2488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8066  -20.4219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0201  -20.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5340  -20.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0203  -21.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7083  -20.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3006  -20.1198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4756  -20.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0620  -20.8355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3032  -21.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4792  -21.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2307  -22.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9012  -22.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5638  -22.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0933  -22.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8091  -22.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8118  -21.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0929  -21.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3802  -21.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5275  -21.2536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7  2  1  0
  2 10  1  0
  4 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 21  1  0
 20 16  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
 10 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 10  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559234

    ---

Associated Targets(Human)

JAK1 Tclin Tyrosine-protein kinase JAK1 (8569 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
JAK2 Tclin Tyrosine-protein kinase JAK2 (12915 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.48Molecular Weight (Monoisotopic): 426.1274AlogP: 2.99#Rotatable Bonds: 4
Polar Surface Area: 96.77Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.89CX Basic pKa: 3.91CX LogP: 1.98CX LogD: 1.98
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.74

References

1. Jiang F, Zang L, Miao X, Jia F, Wang J, Zhu M, Gong P, Jiang N, Zhai X..  (2019)  Design, synthesis and anti-inflammatory evaluation of novel pyrrolo[2,3-d]pyrimidin derivatives as potent JAK inhibitors.,  27  (18): [PMID:31378597] [10.1016/j.bmc.2019.07.037]

Source