1-(3-(5-Benzhydryl-1H-tetrazol-1-yl)propyl)-4-(2,6-dimethylphenyl)piperazine

ID: ALA4559266

PubChem CID: 155558122

Max Phase: Preclinical

Molecular Formula: C29H34N6

Molecular Weight: 466.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1N1CCN(CCCn2nnnc2C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C29H34N6/c1-23-11-9-12-24(2)28(23)34-21-19-33(20-22-34)17-10-18-35-29(30-31-32-35)27(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-9,11-16,27H,10,17-22H2,1-2H3

Standard InChI Key:  BSDVYWZICLTEPH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   27.8535   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5340   -4.1718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3022   -3.3799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4749   -3.3570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2017   -4.1346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3111   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9396   -3.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8300   -5.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1041   -5.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5325   -5.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5059   -6.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2076   -7.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9345   -6.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9555   -5.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2531   -5.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4045   -5.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6790   -5.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6550   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3625   -7.0685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0851   -6.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7167   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3452   -3.6571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1188   -3.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7459   -3.4051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6015   -2.5925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8241   -2.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1912   -2.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2293   -2.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0059   -2.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6361   -1.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4909   -0.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7099   -0.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0830   -1.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1506   -3.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3062   -0.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  1  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  9  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 25 28  1  0
 29 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559266

    ---

Associated Targets(Human)

SLC6A3 Tclin Dopamine transporter (10535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A2 Tclin Norepinephrine transporter (10102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.63Molecular Weight (Monoisotopic): 466.2845AlogP: 4.68#Rotatable Bonds: 8
Polar Surface Area: 50.08Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.92CX LogP: 5.83CX LogD: 5.20
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.48

References

1. Paudel S, Acharya S, Yoon G, Kim KM, Cheon SH..  (2016)  Exploration of substituted arylpiperazine-tetrazoles as promising dual norepinephrine and dopamine reuptake inhibitors.,  24  (21): [PMID:27647372] [10.1016/j.bmc.2016.09.005]

Source