The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(5-Benzhydryl-1H-tetrazol-1-yl)propyl)-4-(2,6-dimethylphenyl)piperazine ID: ALA4559266
PubChem CID: 155558122
Max Phase: Preclinical
Molecular Formula: C29H34N6
Molecular Weight: 466.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(C)c1N1CCN(CCCn2nnnc2C(c2ccccc2)c2ccccc2)CC1
Standard InChI: InChI=1S/C29H34N6/c1-23-11-9-12-24(2)28(23)34-21-19-33(20-22-34)17-10-18-35-29(30-31-32-35)27(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-9,11-16,27H,10,17-22H2,1-2H3
Standard InChI Key: BSDVYWZICLTEPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
27.8535 -4.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5340 -4.1718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3022 -3.3799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4749 -3.3570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2017 -4.1346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3111 -4.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9396 -3.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8300 -5.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1041 -5.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5325 -5.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5059 -6.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2076 -7.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9345 -6.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9555 -5.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2531 -5.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4045 -5.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6790 -5.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6550 -6.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3625 -7.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0851 -6.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7167 -4.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3452 -3.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1188 -3.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7459 -3.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6015 -2.5925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8241 -2.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1912 -2.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2293 -2.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0059 -2.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6361 -1.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4909 -0.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7099 -0.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0830 -1.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1506 -3.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3062 -0.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
2 6 1 0
6 7 1 0
1 8 1 0
8 9 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 9 1 0
7 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 28 1 0
29 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.63Molecular Weight (Monoisotopic): 466.2845AlogP: 4.68#Rotatable Bonds: 8Polar Surface Area: 50.08Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.92CX LogP: 5.83CX LogD: 5.20Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.48
References 1. Paudel S, Acharya S, Yoon G, Kim KM, Cheon SH.. (2016) Exploration of substituted arylpiperazine-tetrazoles as promising dual norepinephrine and dopamine reuptake inhibitors., 24 (21): [PMID:27647372 ] [10.1016/j.bmc.2016.09.005 ]