The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-2-(4-(3-(3-chlorophenyl)acryloyl)phenoxy)-N-(2-oxotetrahydrofuran-3-yl)acetamide ID: ALA4559316
PubChem CID: 155557931
Max Phase: Preclinical
Molecular Formula: C21H18ClNO5
Molecular Weight: 399.83
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc(C(=O)/C=C/c2cccc(Cl)c2)cc1)N[C@H]1CCOC1=O
Standard InChI: InChI=1S/C21H18ClNO5/c22-16-3-1-2-14(12-16)4-9-19(24)15-5-7-17(8-6-15)28-13-20(25)23-18-10-11-27-21(18)26/h1-9,12,18H,10-11,13H2,(H,23,25)/b9-4+/t18-/m0/s1
Standard InChI Key: NBDIYNZUBQQWIX-URPWPPKMSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
26.4488 -13.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2660 -13.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5204 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8574 -12.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1987 -12.8852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2281 -12.4766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8562 -11.5859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9358 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6435 -12.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9358 -13.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3512 -12.8852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0589 -12.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7654 -12.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4726 -12.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4731 -11.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7604 -11.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0561 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1802 -11.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8885 -11.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1791 -10.4367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5957 -11.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3039 -11.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3026 -12.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0101 -12.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7182 -12.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7145 -11.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0065 -11.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4202 -11.2422 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 1 1
4 7 2 0
6 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.83Molecular Weight (Monoisotopic): 399.0874AlogP: 3.05#Rotatable Bonds: 7Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.49CX Basic pKa: ┄CX LogP: 2.96CX LogD: 2.96Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: -0.76
References 1. Yu B, Liu H, Kong X, Chen X, Wu C.. (2019) Synthesis of new chalcone-based homoserine lactones and their antiproliferative activity evaluation., 163 [PMID:30553142 ] [10.1016/j.ejmech.2018.12.014 ]