The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-3-(3-(1-(2-morpholinoethyl)-1H-pyrazol-4-yl)-1H-indazol-6-yl)-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4559322
PubChem CID: 155557936
Max Phase: Preclinical
Molecular Formula: C31H29F3N6O2
Molecular Weight: 574.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1ccc2c(-c3cnn(CCN4CCOCC4)c3)n[nH]c2c1
Standard InChI: InChI=1S/C31H29F3N6O2/c1-20-5-6-22(30(41)36-25-4-2-3-24(17-25)31(32,33)34)15-27(20)21-7-8-26-28(16-21)37-38-29(26)23-18-35-40(19-23)10-9-39-11-13-42-14-12-39/h2-8,15-19H,9-14H2,1H3,(H,36,41)(H,37,38)
Standard InChI Key: JJQCGTDHNYRBRY-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
33.2404 -2.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9501 -2.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9473 -1.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2386 -0.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6504 -0.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3599 -1.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0656 -0.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0630 -0.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3488 0.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6460 -0.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9356 0.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7747 -1.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7773 -2.2019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4810 -0.9738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1901 -1.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1892 -2.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8974 -2.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6047 -2.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5994 -1.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8906 -0.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5324 -2.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5336 -1.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7574 -1.1445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2764 -1.8044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7554 -2.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3068 -0.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9482 -0.5771 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1071 -1.2513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.4374 -0.1093 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.5055 -3.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7280 -3.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7268 -4.3127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5037 -4.5664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9848 -3.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7551 -5.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2074 -5.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4589 -6.7280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9087 -7.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1572 -8.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9557 -8.2825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5054 -7.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2566 -6.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 22 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
10 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
26 27 1 0
26 28 1 0
26 29 1 0
19 26 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
25 30 1 0
33 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.61Molecular Weight (Monoisotopic): 574.2304AlogP: 6.01#Rotatable Bonds: 7Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.32CX Basic pKa: 6.91CX LogP: 5.69CX LogD: 5.57Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.25Np Likeness Score: -1.88
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]