(R)-N-(3-methoxy-4-(2-((3aS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidine-1-carbonyl)phenyl)acetamide

ID: ALA4559324

PubChem CID: 155557938

Max Phase: Preclinical

Molecular Formula: C24H33BN2O5

Molecular Weight: 440.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(NC(C)=O)ccc1C(=O)N1CCC[C@H]1B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1

Standard InChI:  InChI=1S/C24H33BN2O5/c1-14(28)26-16-8-9-17(18(13-16)30-5)22(29)27-10-6-7-21(27)25-31-20-12-15-11-19(23(15,2)3)24(20,4)32-25/h8-9,13,15,19-21H,6-7,10-12H2,1-5H3,(H,26,28)/t15-,19-,20+,21-,24-/m0/s1

Standard InChI Key:  AKWLBANFCWCWKL-PJFMLXMNSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   21.0830  -14.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0818  -15.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7977  -15.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5110  -15.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5082  -14.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7959  -13.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3673  -13.7785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6518  -14.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9362  -13.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6520  -15.0149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2273  -15.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2286  -16.2559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9422  -15.0143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6937  -15.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2465  -14.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8305  -14.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0231  -14.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6856  -16.1680    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   24.0177  -16.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3492  -16.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0890  -17.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2680  -17.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8505  -18.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2534  -18.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4923  -18.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4409  -17.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9137  -17.4417    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.6731  -18.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0838  -18.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8362  -19.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4243  -18.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5021  -19.5593    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0249  -18.1324    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.7986  -16.2572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5134  -16.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  4 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 14 18  1  1
 18 19  1  0
 19 22  1  0
 21 20  1  0
 20 18  1  0
 21 22  1  0
 21 25  1  0
 22 23  1  0
 23 24  1  0
 24 29  1  0
 29 25  1  0
 22 26  1  1
 21 27  1  1
 23 28  1  0
 29 28  1  0
 24 30  1  0
 24 31  1  0
 29 32  1  6
 23 33  1  6
  3 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559324

    ---

Associated Targets(Human)

PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.35Molecular Weight (Monoisotopic): 440.2483AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Plescia J, Dufresne C, Janmamode N, Wahba AS, Mittermaier AK, Moitessier N..  (2020)  Discovery of covalent prolyl oligopeptidase boronic ester inhibitors.,  185  [PMID:31732257] [10.1016/j.ejmech.2019.111783]

Source