2-Imino-N-(3-morpholinopropyl)-5-oxo-1-(2-(thiophen-2-yl)ethyl)-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4559438

PubChem CID: 155558065

Max Phase: Preclinical

Molecular Formula: C25H28N6O3S

Molecular Weight: 492.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=c1c(C(=O)NCCCN2CCOCC2)cc2c(=O)n3ccccc3nc2n1CCc1cccs1

Standard InChI:  InChI=1S/C25H28N6O3S/c26-22-19(24(32)27-8-4-9-29-12-14-34-15-13-29)17-20-23(31(22)11-7-18-5-3-16-35-18)28-21-6-1-2-10-30(21)25(20)33/h1-3,5-6,10,16-17,26H,4,7-9,11-15H2,(H,27,32)

Standard InChI Key:  SNRQGLDPQUZXBD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   25.1224   -5.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1224   -6.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8318   -6.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8318   -4.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5413   -5.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5423   -6.0258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2466   -6.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2445   -4.7927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9575   -5.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9578   -6.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6676   -6.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3816   -6.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3813   -5.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6670   -4.7905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2459   -7.2566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0934   -4.7940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0930   -6.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0921   -7.2602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8052   -6.0269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5166   -6.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6655   -3.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3767   -3.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3752   -2.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0361   -2.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7810   -1.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9596   -1.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7073   -2.2520    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.2307   -6.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9362   -6.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6502   -6.0432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3583   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0702   -6.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0788   -5.2352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3694   -4.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6513   -5.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  7 15  2  0
 13 16  2  0
 12 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 14 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
 20 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559438

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.61Molecular Weight (Monoisotopic): 492.1944AlogP: 1.88#Rotatable Bonds: 8
Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.49CX LogP: 1.22CX LogD: 0.81
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -2.25

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source