The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Imino-N-(3-morpholinopropyl)-5-oxo-1-(2-(thiophen-2-yl)ethyl)-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide ID: ALA4559438
PubChem CID: 155558065
Max Phase: Preclinical
Molecular Formula: C25H28N6O3S
Molecular Weight: 492.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N=c1c(C(=O)NCCCN2CCOCC2)cc2c(=O)n3ccccc3nc2n1CCc1cccs1
Standard InChI: InChI=1S/C25H28N6O3S/c26-22-19(24(32)27-8-4-9-29-12-14-34-15-13-29)17-20-23(31(22)11-7-18-5-3-16-35-18)28-21-6-1-2-10-30(21)25(20)33/h1-3,5-6,10,16-17,26H,4,7-9,11-15H2,(H,27,32)
Standard InChI Key: SNRQGLDPQUZXBD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
25.1224 -5.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1224 -6.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8318 -6.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8318 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5413 -5.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5423 -6.0258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2466 -6.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2445 -4.7927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9575 -5.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9578 -6.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6676 -6.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3816 -6.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3813 -5.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6670 -4.7905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2459 -7.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0934 -4.7940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0930 -6.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0921 -7.2602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8052 -6.0269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5166 -6.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6655 -3.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3767 -3.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3752 -2.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0361 -2.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7810 -1.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9596 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7073 -2.2520 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.2307 -6.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9362 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6502 -6.0432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3583 -6.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0702 -6.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0788 -5.2352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3694 -4.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6513 -5.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 2 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
7 15 2 0
13 16 2 0
12 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
14 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.61Molecular Weight (Monoisotopic): 492.1944AlogP: 1.88#Rotatable Bonds: 8Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.49CX LogP: 1.22CX LogD: 0.81Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -2.25
References 1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG.. (2020) Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer., 63 (9): [PMID:32297747 ] [10.1021/acs.jmedchem.0c00161 ]