The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Brachangobinan J ID: ALA4559458
PubChem CID: 155557775
Max Phase: Preclinical
Molecular Formula: C23H26O8
Molecular Weight: 430.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2Oc3c(OC)cc(C(=O)O)cc3[C@H]2COC(=O)CC(C)C)ccc1O
Standard InChI: InChI=1S/C23H26O8/c1-12(2)7-20(25)30-11-16-15-8-14(23(26)27)10-19(29-4)22(15)31-21(16)13-5-6-17(24)18(9-13)28-3/h5-6,8-10,12,16,21,24H,7,11H2,1-4H3,(H,26,27)/t16-,21+/m1/s1
Standard InChI Key: LVWZYRSQVBHEHU-IERDGZPVSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
35.3536 -20.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0632 -20.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0604 -19.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3518 -19.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3534 -21.6913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6456 -22.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7666 -19.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6455 -20.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6467 -19.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8705 -19.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3896 -20.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8686 -20.7162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5757 -20.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1687 -19.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3523 -19.3447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9419 -20.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3538 -20.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1689 -20.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1247 -20.0523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9451 -18.6362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1279 -18.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6192 -18.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1670 -18.0110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9156 -17.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4634 -16.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1165 -17.0623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2624 -16.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8102 -16.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5138 -17.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7635 -18.4135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4758 -19.6366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 9 1 0
1 5 1 0
5 6 1 0
3 7 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 1
16 19 1 0
15 20 1 0
20 21 1 0
10 22 1 6
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
27 29 1 0
7 30 2 0
7 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.45Molecular Weight (Monoisotopic): 430.1628AlogP: 3.91#Rotatable Bonds: 8Polar Surface Area: 111.52Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.09CX Basic pKa: ┄CX LogP: 3.52CX LogD: 0.42Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: 1.38
References 1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K.. (2019) Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity., 82 (4): [PMID:30896183 ] [10.1021/acs.jnatprod.8b00670 ]