(S)-N-(1-(3-(4-(3-aminopropylamino)butylamino)propylamino)-3-cyclohexyl-1-oxopropan-2-yl)cyclobutanecarboxamide

ID: ALA4559471

PubChem CID: 155557819

Max Phase: Preclinical

Molecular Formula: C24H47N5O2

Molecular Weight: 437.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCNCCCCNCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)C1CCC1

Standard InChI:  InChI=1S/C24H47N5O2/c25-13-7-16-26-14-4-5-15-27-17-8-18-28-24(31)22(19-20-9-2-1-3-10-20)29-23(30)21-11-6-12-21/h20-22,26-27H,1-19,25H2,(H,28,31)(H,29,30)/t22-/m0/s1

Standard InChI Key:  FOBOXOHWDKQRAH-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   20.5495  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2572  -29.2621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8418  -29.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1341  -29.6706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1341  -30.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4222  -30.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8418  -30.8964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8418  -28.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1341  -28.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9649  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6726  -29.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3803  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0880  -29.2621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7957  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5034  -29.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2111  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9188  -29.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6266  -29.6706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3343  -29.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0461  -29.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7497  -29.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4574  -29.6706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5495  -30.4878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1317  -27.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4281  -26.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7180  -27.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7160  -28.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4242  -28.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6307  -30.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4163  -31.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2085  -31.6861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  3  8  1  1
  8  9  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  1 23  2  0
  9 24  1  0
  9 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
  6 29  1  0
 29 30  1  0
 30 31  1  0
 31  6  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559471

    ---

Associated Targets(Human)

CHRNB4 Tclin Neuronal acetylcholine receptor; alpha3/beta4 (2283 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHRNB2 Tclin Neuronal acetylcholine receptor; alpha4/beta2 (3972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.67Molecular Weight (Monoisotopic): 437.3730AlogP: 2.06#Rotatable Bonds: 17
Polar Surface Area: 108.28Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.08CX Basic pKa: 10.79CX LogP: 1.18CX LogD: -5.33
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.22Np Likeness Score: -0.30

References

1. Kachel HS, Franzyk H, Mellor IR..  (2019)  Philanthotoxin Analogues That Selectively Inhibit Ganglionic Nicotinic Acetylcholine Receptors with Exceptional Potency.,  62  (13): [PMID:31244109] [10.1021/acs.jmedchem.9b00519]

Source