The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-6-Amino-5-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)-1'-(2-(dimethylamino)ethyl)[3,4'-bipyridin]-2'(1'H)-one ID: ALA4559485
PubChem CID: 155557858
Max Phase: Preclinical
Molecular Formula: C22H23Cl2FN4O2
Molecular Weight: 465.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](Oc1cc(-c2ccn(CCN(C)C)c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl
Standard InChI: InChI=1S/C22H23Cl2FN4O2/c1-13(20-16(23)4-5-17(25)21(20)24)31-18-10-15(12-27-22(18)26)14-6-7-29(19(30)11-14)9-8-28(2)3/h4-7,10-13H,8-9H2,1-3H3,(H2,26,27)/t13-/m1/s1
Standard InChI Key: NFAGZVGAXFNBPX-CYBMUJFWSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
42.3605 -4.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3593 -5.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0674 -5.6570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7770 -5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7742 -4.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0656 -4.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6534 -4.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6551 -3.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9514 -2.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2414 -3.1945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2396 -4.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9479 -4.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4854 -5.6550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9543 -1.9720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.4804 -4.0136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.4773 -3.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1834 -2.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8880 -3.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5936 -2.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5910 -1.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8768 -1.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1740 -1.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7680 -2.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8881 -4.0118 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
44.4624 -1.5714 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
47.3027 -3.1903 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.5351 -2.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8260 -3.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1197 -2.7784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1226 -1.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4106 -3.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
1 7 1 0
4 13 1 0
9 14 2 0
5 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
16 23 1 6
18 24 1 0
22 25 1 0
19 26 1 0
10 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.36Molecular Weight (Monoisotopic): 464.1182AlogP: 4.64#Rotatable Bonds: 7Polar Surface Area: 73.38Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.32CX LogP: 3.66CX LogD: 2.67Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -1.19
References 1. Chen W, Guo X, Zhang C, Ke D, Zhang G, Yu Y.. (2019) Discovery of 2-aminopyridines bearing a pyridone moiety as potent ALK inhibitors to overcome the crizotinib-resistant mutants., 183 [PMID:31569004 ] [10.1016/j.ejmech.2019.111734 ]