The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-acetamidoethyl)-8-chloro-N-(cyclohexylmethyl)-1-methyl-1,4-dihydrochromeno[4,3-c]pyrazole-3-carboxamide ID: ALA4559492
PubChem CID: 155557882
Max Phase: Preclinical
Molecular Formula: C23H29ClN4O3
Molecular Weight: 444.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCCN(CC1CCCCC1)C(=O)c1nn(C)c2c1COc1ccc(Cl)cc1-2
Standard InChI: InChI=1S/C23H29ClN4O3/c1-15(29)25-10-11-28(13-16-6-4-3-5-7-16)23(30)21-19-14-31-20-9-8-17(24)12-18(20)22(19)27(2)26-21/h8-9,12,16H,3-7,10-11,13-14H2,1-2H3,(H,25,29)
Standard InChI Key: BIPJSWDGVJGWPM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
14.9722 -3.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9710 -3.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6791 -4.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6773 -2.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3859 -3.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3847 -3.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0909 -4.2967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8028 -3.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0933 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8022 -3.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4107 -2.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0778 -1.7691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2636 -1.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7169 -1.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2246 -2.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6364 -3.2193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6300 -1.8039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4536 -3.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8654 -3.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6826 -3.9178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0880 -3.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9051 -3.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6762 -2.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2310 -3.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6428 -4.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2644 -2.6622 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.2339 -5.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6422 -6.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4597 -6.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8673 -5.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4573 -4.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
13 14 1 0
11 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
16 24 1 0
24 25 1 0
1 26 1 0
25 27 1 0
25 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.96Molecular Weight (Monoisotopic): 444.1928AlogP: 3.79#Rotatable Bonds: 6Polar Surface Area: 76.46Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.73Np Likeness Score: -1.25
References 1. Chianelli D, Rucker PV, Roland J, Tully DC, Nelson J, Liu X, Bursulaya B, Hernandez ED, Wu J, Prashad M, Schlama T, Liu Y, Chu A, Schmeits J, Huang DJ, Hill R, Bao D, Zoll J, Kim Y, Groessl T, McNamara P, Liu B, Richmond W, Sancho-Martinez I, Phimister A, Seidel HM, Badman MK, Joseph SB, Laffitte B, Molteni V.. (2020) Nidufexor (LMB763), a Novel FXR Modulator for the Treatment of Nonalcoholic Steatohepatitis., 63 (8): [PMID:31940200 ] [10.1021/acs.jmedchem.9b01621 ]