N-(3-(benzylcarbamoyl)-1-methyl-1H-pyrazol-4-yl)-2'-(cyclopropylmethylamino)-2,4'-bipyridine-6-carboxamide

ID: ALA4559539

PubChem CID: 155558108

Max Phase: Preclinical

Molecular Formula: C27H27N7O2

Molecular Weight: 481.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(NC(=O)c2cccc(-c3ccnc(NCC4CC4)c3)n2)c(C(=O)NCc2ccccc2)n1

Standard InChI:  InChI=1S/C27H27N7O2/c1-34-17-23(25(33-34)27(36)30-16-18-6-3-2-4-7-18)32-26(35)22-9-5-8-21(31-22)20-12-13-28-24(14-20)29-15-19-10-11-19/h2-9,12-14,17,19H,10-11,15-16H2,1H3,(H,28,29)(H,30,36)(H,32,35)

Standard InChI Key:  GSFBXBSFIZFBSP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    4.2414  -12.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2402  -13.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9483  -14.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6579  -13.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6551  -12.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9465  -12.5093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9499  -14.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2405  -15.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2400  -16.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9481  -16.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6583  -16.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6553  -15.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5336  -12.5098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8260  -12.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1181  -12.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7072  -11.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2987  -12.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3673  -16.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3700  -17.4062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0737  -16.1781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6636  -17.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9112  -17.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3664  -18.0989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7773  -18.8054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5761  -18.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1837  -19.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0143  -19.9786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9607  -18.9262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5534  -18.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5683  -19.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3454  -19.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9495  -19.7668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7259  -19.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8959  -18.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2834  -18.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5094  -18.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 15 17  1  0
 11 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 23 29  1  0
 28 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559539

    ---

Associated Targets(Human)

IRAK4 Tchem Interleukin-1 receptor-associated kinase 4 (5917 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.56Molecular Weight (Monoisotopic): 481.2226AlogP: 3.88#Rotatable Bonds: 9
Polar Surface Area: 113.83Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.04CX Basic pKa: 5.66CX LogP: 4.16CX LogD: 4.15
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.57

References

1. Hanisak J, Seganish WM, McElroy WT, Tang H, Zhang R, Tsui HC, Fischmann T, Tulshian D, Tata J, Sondey C, Devito K, Fossetta J, Garlisi CG, Lundell D, Niu X..  (2016)  Efforts towards the optimization of a bi-aryl class of potent IRAK4 inhibitors.,  26  (17): [PMID:27476420] [10.1016/j.bmcl.2016.07.048]

Source