The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(benzylcarbamoyl)-1-methyl-1H-pyrazol-4-yl)-2'-(cyclopropylmethylamino)-2,4'-bipyridine-6-carboxamide ID: ALA4559539
PubChem CID: 155558108
Max Phase: Preclinical
Molecular Formula: C27H27N7O2
Molecular Weight: 481.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(NC(=O)c2cccc(-c3ccnc(NCC4CC4)c3)n2)c(C(=O)NCc2ccccc2)n1
Standard InChI: InChI=1S/C27H27N7O2/c1-34-17-23(25(33-34)27(36)30-16-18-6-3-2-4-7-18)32-26(35)22-9-5-8-21(31-22)20-12-13-28-24(14-20)29-15-19-10-11-19/h2-9,12-14,17,19H,10-11,15-16H2,1H3,(H,28,29)(H,30,36)(H,32,35)
Standard InChI Key: GSFBXBSFIZFBSP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
4.2414 -12.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2402 -13.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9483 -14.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6579 -13.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6551 -12.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9465 -12.5093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9499 -14.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2405 -15.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2400 -16.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9481 -16.5955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6583 -16.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6553 -15.3677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5336 -12.5098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8260 -12.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1181 -12.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7072 -11.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2987 -12.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3673 -16.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3700 -17.4062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0737 -16.1781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6636 -17.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9112 -17.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3664 -18.0989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7773 -18.8054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5761 -18.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1837 -19.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0143 -19.9786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9607 -18.9262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5534 -18.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5683 -19.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3454 -19.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9495 -19.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7259 -19.5143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8959 -18.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2834 -18.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5094 -18.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
1 13 1 0
13 14 1 0
14 15 1 0
16 15 1 0
17 16 1 0
15 17 1 0
11 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
25 26 1 0
26 27 2 0
26 28 1 0
23 29 1 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.56Molecular Weight (Monoisotopic): 481.2226AlogP: 3.88#Rotatable Bonds: 9Polar Surface Area: 113.83Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.04CX Basic pKa: 5.66CX LogP: 4.16CX LogD: 4.15Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.57
References 1. Hanisak J, Seganish WM, McElroy WT, Tang H, Zhang R, Tsui HC, Fischmann T, Tulshian D, Tata J, Sondey C, Devito K, Fossetta J, Garlisi CG, Lundell D, Niu X.. (2016) Efforts towards the optimization of a bi-aryl class of potent IRAK4 inhibitors., 26 (17): [PMID:27476420 ] [10.1016/j.bmcl.2016.07.048 ]