(E)-N-((3R,3aR,3a1S,9R,9aR)-9-(N-(cyclopropylmethyl)phenylsulfonamido)-5-methoxy-1,2,3,3a,3a1,8,9,9a-octahydrophenanthro[4,5-bcd]furan-3-yl)-3-(furan-3-yl)-N-methylacrylamide

ID: ALA4559564

PubChem CID: 155557825

Max Phase: Preclinical

Molecular Formula: C33H36N2O6S

Molecular Weight: 588.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c1O[C@@H]1[C@H]3[C@@H](CC[C@H]1N(C)C(=O)/C=C/c1ccoc1)[C@H](N(CC1CC1)S(=O)(=O)c1ccccc1)C2

Standard InChI:  InChI=1S/C33H36N2O6S/c1-34(29(36)15-10-22-16-17-40-20-22)26-13-12-25-27(18-23-11-14-28(39-2)33-30(23)31(25)32(26)41-33)35(19-21-8-9-21)42(37,38)24-6-4-3-5-7-24/h3-7,10-11,14-17,20-21,25-27,31-32H,8-9,12-13,18-19H2,1-2H3/b15-10+/t25-,26+,27+,31-,32-/m0/s1

Standard InChI Key:  VTGLFMAGTSQXRC-QLWSVJHKSA-N

Molfile:  

 
     RDKit          2D

 45 51  0  0  0  0  0  0  0  0999 V2000
   28.1890   -2.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7845   -3.4834    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.6015   -3.4787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9109   -4.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2133   -4.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9133   -5.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5976   -4.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6024   -5.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0838   -5.1105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5141   -4.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2181   -5.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5165   -5.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2109   -3.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6077   -3.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6048   -6.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2206   -6.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9060   -3.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9181   -7.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3274   -7.0945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3103   -3.0744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7999   -4.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0989   -4.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0724   -3.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0618   -2.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3506   -1.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6529   -2.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6709   -3.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3827   -3.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1121   -5.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7176   -6.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5347   -6.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0132   -3.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7257   -3.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4285   -3.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1410   -3.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3199   -2.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0037   -4.3083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8828   -3.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4367   -2.8478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0364   -2.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2351   -2.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3009   -3.8631    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9059   -3.8548    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.3295   -7.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2084   -5.0847    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  4  6  1  0
  7  4  1  0
  8  6  2  0
  9  7  1  0
 10  5  1  0
 11  6  1  0
 12 11  1  0
 13  5  1  0
 14  7  1  0
 15  8  1  0
 16 11  2  0
 17 14  1  0
 18 16  1  0
 19 15  1  0
  8  9  1  0
 17 13  1  0
 12 10  1  0
 18 15  2  0
 14 20  1  1
 10 21  1  1
 21  2  1  0
 21 22  1  0
  2 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 29  1  0
 30 29  1  0
 31 30  1  0
 29 31  1  0
 20 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 20 36  1  0
 32 37  2  0
 35 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  2  0
 41 35  1  0
  7 42  1  1
  4 43  1  1
 19 44  1  0
  5 45  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4559564

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCRTR1 Tclin Orexin receptor 1 (5435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 588.73Molecular Weight (Monoisotopic): 588.2294AlogP: 5.11#Rotatable Bonds: 9
Polar Surface Area: 89.29Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: 0.06

References

1. Saitoh T, Seki K, Nakajima R, Yamamoto N, Kutsumura N, Nagumo Y, Irukayama-Tomobe Y, Ogawa Y, Ishikawa Y, Tanimura R, Yanagisawa M, Nagase H..  (2019)  Essential structure of orexin 1 receptor antagonist YNT-707, Part IV: The role of D-ring in 4,5-epoxymorphinan on the orexin 1 receptor antagonistic activity.,  29  (18): [PMID:31375290] [10.1016/j.bmcl.2019.07.039]

Source