N-(5-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-2-methylphenyl)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclopropanecarboxamide

ID: ALA4559599

PubChem CID: 155557982

Max Phase: Preclinical

Molecular Formula: C25H20ClF3N6O2

Molecular Weight: 528.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1NC(=O)C1(c2ncnc3[nH]ccc23)CC1

Standard InChI:  InChI=1S/C25H20ClF3N6O2/c1-13-2-3-15(34-23(37)33-14-4-5-18(26)17(10-14)25(27,28)29)11-19(13)35-22(36)24(7-8-24)20-16-6-9-30-21(16)32-12-31-20/h2-6,9-12H,7-8H2,1H3,(H,35,36)(H,30,31,32)(H2,33,34,37)

Standard InChI Key:  HUUUALQMTYEFAV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   36.8974   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7146   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3060   -2.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0157   -4.2262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0145   -5.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7226   -5.4547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.7208   -3.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4294   -4.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4297   -5.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2083   -5.2940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6894   -4.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2079   -3.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4249   -2.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4276   -1.7723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1312   -3.0005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8403   -2.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5440   -3.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2526   -2.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2558   -1.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5445   -1.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8388   -1.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1307   -1.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9588   -3.0128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.6680   -2.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3742   -3.0183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.6712   -1.7898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0834   -2.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7854   -3.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4942   -2.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4978   -1.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7867   -1.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0808   -1.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2065   -1.3950    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   46.2001   -3.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1966   -3.8487    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   46.9096   -2.6260    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   46.9018   -3.4380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  7  2  1  0
  2 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 29 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559599

    ---

Associated Targets(Human)

BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.92Molecular Weight (Monoisotopic): 528.1288AlogP: 6.25#Rotatable Bonds: 5
Polar Surface Area: 111.80Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.47CX Basic pKa: 4.14CX LogP: 5.75CX LogD: 5.75
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -1.40

References

1. Wang L, Zhang Y, Zhang Q, Zhu G, Zhang Z, Duan C, Lu T, Tang W..  (2019)  Discovery of potent Pan-Raf inhibitors with increased solubility to overcome drug resistance.,  163  [PMID:30529543] [10.1016/j.ejmech.2018.11.033]

Source