The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-2-methylphenyl)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclopropanecarboxamide ID: ALA4559599
PubChem CID: 155557982
Max Phase: Preclinical
Molecular Formula: C25H20ClF3N6O2
Molecular Weight: 528.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1NC(=O)C1(c2ncnc3[nH]ccc23)CC1
Standard InChI: InChI=1S/C25H20ClF3N6O2/c1-13-2-3-15(34-23(37)33-14-4-5-18(26)17(10-14)25(27,28)29)11-19(13)35-22(36)24(7-8-24)20-16-6-9-30-21(16)32-12-31-20/h2-6,9-12H,7-8H2,1H3,(H,35,36)(H,30,31,32)(H2,33,34,37)
Standard InChI Key: HUUUALQMTYEFAV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
36.8974 -2.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7146 -2.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3060 -2.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0157 -4.2262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0145 -5.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7226 -5.4547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7208 -3.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4294 -4.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4297 -5.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2083 -5.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6894 -4.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2079 -3.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4249 -2.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4276 -1.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1312 -3.0005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8403 -2.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5440 -3.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2526 -2.6015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2558 -1.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5445 -1.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8388 -1.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1307 -1.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9588 -3.0128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6680 -2.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3742 -3.0183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6712 -1.7898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0834 -2.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7854 -3.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4942 -2.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4978 -1.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7867 -1.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0808 -1.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2065 -1.3950 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
46.2001 -3.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1966 -3.8487 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.9096 -2.6260 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.9018 -3.4380 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
7 2 1 0
2 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
21 22 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
29 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.92Molecular Weight (Monoisotopic): 528.1288AlogP: 6.25#Rotatable Bonds: 5Polar Surface Area: 111.80Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.47CX Basic pKa: 4.14CX LogP: 5.75CX LogD: 5.75Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -1.40
References 1. Wang L, Zhang Y, Zhang Q, Zhu G, Zhang Z, Duan C, Lu T, Tang W.. (2019) Discovery of potent Pan-Raf inhibitors with increased solubility to overcome drug resistance., 163 [PMID:30529543 ] [10.1016/j.ejmech.2018.11.033 ]