The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-((((2R,3S,4R,5R)-5-(4-amino-5-chloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)(isopropyl)amino)propyl)-3-(4-tert-butylphenyl)urea ID: ALA4559614
PubChem CID: 155558010
Max Phase: Preclinical
Molecular Formula: C28H40ClN7O4
Molecular Weight: 574.13
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N(CCCNC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2cc(Cl)c3c(N)ncnc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C28H40ClN7O4/c1-16(2)35(12-6-11-31-27(39)34-18-9-7-17(8-10-18)28(3,4)5)14-20-22(37)23(38)26(40-20)36-13-19(29)21-24(30)32-15-33-25(21)36/h7-10,13,15-16,20,22-23,26,37-38H,6,11-12,14H2,1-5H3,(H2,30,32,33)(H2,31,34,39)/t20-,22-,23-,26-/m1/s1
Standard InChI Key: BYNIEOFYNNLCCW-HUBRGWSESA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
36.6935 -13.3632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3978 -12.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0801 -12.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2142 -12.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3919 -12.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1685 -13.1849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7681 -12.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5859 -11.8345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8095 -11.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6280 -10.7990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6211 -14.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9202 -14.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1028 -15.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9169 -15.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2372 -14.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5658 -16.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0337 -14.5316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3367 -16.1672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7638 -15.8523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2267 -16.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4990 -15.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0360 -14.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6970 -14.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4248 -16.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8877 -16.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0858 -16.7698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5487 -17.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7468 -17.2286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8136 -18.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2097 -17.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4102 -17.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8733 -18.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1381 -19.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9446 -19.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4780 -18.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6018 -19.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7997 -19.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8677 -20.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0198 -20.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9771 -11.3726 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
11 1 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
13 16 1 1
15 17 1 6
14 18 1 6
16 19 1 0
19 20 1 0
19 21 1 0
21 22 1 0
21 23 1 0
20 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
2 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.13Molecular Weight (Monoisotopic): 573.2830AlogP: 3.51#Rotatable Bonds: 9Polar Surface Area: 150.79Molecular Species: BASEHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.45CX Basic pKa: 8.63CX LogP: 3.34CX LogD: 2.08Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.76
References 1. Spurr SS, Bayle ED, Yu W, Li F, Tempel W, Vedadi M, Schapira M, Fish PV.. (2016) New small molecule inhibitors of histone methyl transferase DOT1L with a nitrile as a non-traditional replacement for heavy halogen atoms., 26 (18): [PMID:27485386 ] [10.1016/j.bmcl.2016.07.041 ]