The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-(3-chlorophenyl)-2{[4-(o-fluorophenyl)-1-piperazinyl]methyl}pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4559732
PubChem CID: 155558071
Max Phase: Preclinical
Molecular Formula: C25H24ClFN4O2
Molecular Weight: 466.94
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(c(C)n1-c1cccc(Cl)c1)C(=O)N(CN1CCN(c3ccccc3F)CC1)C2=O
Standard InChI: InChI=1S/C25H24ClFN4O2/c1-16-22-23(17(2)31(16)19-7-5-6-18(26)14-19)25(33)30(24(22)32)15-28-10-12-29(13-11-28)21-9-4-3-8-20(21)27/h3-9,14H,10-13,15H2,1-2H3
Standard InChI Key: KBRVEXFINIFEFA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
22.6145 -4.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6535 -3.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1520 -3.7665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4325 -3.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4063 -4.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1825 -4.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6885 -3.8442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2249 -3.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5046 -2.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4124 -5.2883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3357 -5.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4205 -2.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5131 -3.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9028 -4.5976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4612 -5.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8473 -6.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6721 -6.0540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1093 -5.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7216 -4.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0586 -6.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6192 -7.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0055 -8.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8308 -8.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2684 -7.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8797 -6.8059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3153 -6.1052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.3279 -3.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9369 -3.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1130 -2.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6791 -3.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0751 -4.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8977 -4.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7217 -2.2652 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
25 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
3 27 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.94Molecular Weight (Monoisotopic): 466.1572AlogP: 4.26#Rotatable Bonds: 4Polar Surface Area: 48.79Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.02CX LogP: 4.89CX LogD: 4.89Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.73
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]