The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Brachangobinan B ID: ALA4559835
PubChem CID: 155558128
Max Phase: Preclinical
Molecular Formula: C25H30O7
Molecular Weight: 442.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C=O)[C@H](COC(=O)CC(C)C)C(c1ccc(O)c(OC)c1)c1ccc(O)c(OC)c1
Standard InChI: InChI=1S/C25H30O7/c1-15(2)10-24(29)32-14-19(16(3)13-26)25(17-6-8-20(27)22(11-17)30-4)18-7-9-21(28)23(12-18)31-5/h6-9,11-13,15,19,25,27-28H,3,10,14H2,1-2,4-5H3/t19-/m0/s1
Standard InChI Key: QOZYOXIIMYYKQL-IBGZPJMESA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
4.1423 -12.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1412 -13.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8492 -14.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5589 -13.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5561 -12.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8474 -12.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4345 -12.3818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7269 -12.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4331 -14.0178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2622 -12.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9715 -12.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2591 -11.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6776 -12.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3869 -12.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6745 -11.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0930 -12.3647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9745 -13.5985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6838 -14.0044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9671 -11.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9643 -10.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2545 -9.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5460 -10.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5523 -11.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2504 -9.1114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6707 -9.9244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3797 -10.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6869 -14.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3961 -15.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9807 -15.2329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3992 -16.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1084 -16.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6930 -16.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
2 9 1 0
5 10 1 0
10 11 1 0
10 12 1 0
11 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
11 17 1 6
17 18 1 0
12 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 12 1 0
21 24 1 0
20 25 1 0
25 26 1 0
18 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.51Molecular Weight (Monoisotopic): 442.1992AlogP: 4.21#Rotatable Bonds: 11Polar Surface Area: 102.29Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.64CX Basic pKa: ┄CX LogP: 4.09CX LogD: 4.09Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: 0.82
References 1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K.. (2019) Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity., 82 (4): [PMID:30896183 ] [10.1021/acs.jnatprod.8b00670 ]