Brachangobinan B

ID: ALA4559835

PubChem CID: 155558128

Max Phase: Preclinical

Molecular Formula: C25H30O7

Molecular Weight: 442.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C=O)[C@H](COC(=O)CC(C)C)C(c1ccc(O)c(OC)c1)c1ccc(O)c(OC)c1

Standard InChI:  InChI=1S/C25H30O7/c1-15(2)10-24(29)32-14-19(16(3)13-26)25(17-6-8-20(27)22(11-17)30-4)18-7-9-21(28)23(12-18)31-5/h6-9,11-13,15,19,25,27-28H,3,10,14H2,1-2,4-5H3/t19-/m0/s1

Standard InChI Key:  QOZYOXIIMYYKQL-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    4.1423  -12.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1412  -13.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8492  -14.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5589  -13.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5561  -12.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8474  -12.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4345  -12.3818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7269  -12.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4331  -14.0178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2622  -12.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9715  -12.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2591  -11.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6776  -12.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3869  -12.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6745  -11.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0930  -12.3647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9745  -13.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6838  -14.0044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9671  -11.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9643  -10.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2545   -9.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5460  -10.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5523  -11.1593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2504   -9.1114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6707   -9.9244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3797  -10.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6869  -14.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3961  -15.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9807  -15.2329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3992  -16.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1084  -16.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6930  -16.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  2  9  1  0
  5 10  1  0
 10 11  1  0
 10 12  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 11 17  1  6
 17 18  1  0
 12 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 12  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 18 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559835

    ---

Associated Targets(non-human)

Trypanosoma congolense (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.51Molecular Weight (Monoisotopic): 442.1992AlogP: 4.21#Rotatable Bonds: 11
Polar Surface Area: 102.29Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.64CX Basic pKa: CX LogP: 4.09CX LogD: 4.09
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: 0.82

References

1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K..  (2019)  Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity.,  82  (4): [PMID:30896183] [10.1021/acs.jnatprod.8b00670]

Source