The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-methylpiperidin-3-yl 3,4-dimethoxyphenethyl(phenyl)carbamate ID: ALA4559952
PubChem CID: 155510347
Max Phase: Preclinical
Molecular Formula: C23H30N2O4
Molecular Weight: 398.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCN(C(=O)OC2CCCN(C)C2)c2ccccc2)cc1OC
Standard InChI: InChI=1S/C23H30N2O4/c1-24-14-7-10-20(17-24)29-23(26)25(19-8-5-4-6-9-19)15-13-18-11-12-21(27-2)22(16-18)28-3/h4-6,8-9,11-12,16,20H,7,10,13-15,17H2,1-3H3
Standard InChI Key: RXRKWRRWTOGCKS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
16.0783 -1.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0771 -2.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7852 -2.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4948 -2.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4920 -1.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7834 -1.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7850 -3.6594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0772 -4.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0770 -4.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3695 -3.6591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4926 -4.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2004 -3.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9080 -4.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9039 -4.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6107 -5.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3194 -4.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3170 -4.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6097 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0234 -3.6515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7324 -4.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0276 -5.2916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7349 -4.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6617 -4.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9534 -3.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2477 -4.0587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2433 -4.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9508 -5.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6626 -4.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5417 -3.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
10 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
25 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.50Molecular Weight (Monoisotopic): 398.2206AlogP: 3.98#Rotatable Bonds: 7Polar Surface Area: 51.24Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.97CX LogP: 3.88CX LogD: 3.20Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -0.55
References 1. Lee NR, Gujarathi S, Bommagani S, Siripurapu K, Zheng G, Dwoskin LP.. (2019) Muscarinic agonist, (±)-quinuclidin-3-yl-(4-fluorophenethyl)(phenyl)carbamate: High affinity, but low subtype selectivity for human M1 - M5 muscarinic acetylcholine receptors., 29 (3): [PMID:30554957 ] [10.1016/j.bmcl.2018.12.022 ]