5-[3-(Dimethylamino)-1-propyl]thio-3-Isopropyl-7-[4-(2-pyridyl)benzyl]amino-1H-pyrazolo[4,3-d]pyrimidine

ID: ALA4559997

PubChem CID: 155510476

Max Phase: Preclinical

Molecular Formula: C25H31N7S

Molecular Weight: 461.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1n[nH]c2c(NCc3ccc(-c4ccccn4)cc3)nc(SCCCN(C)C)nc12

Standard InChI:  InChI=1S/C25H31N7S/c1-17(2)21-22-23(31-30-21)24(29-25(28-22)33-15-7-14-32(3)4)27-16-18-9-11-19(12-10-18)20-8-5-6-13-26-20/h5-6,8-13,17H,7,14-16H2,1-4H3,(H,30,31)(H,27,28,29)

Standard InChI Key:  GGXSXUJZXIOGMV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   33.6912  -21.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5145  -21.3633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9253  -20.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5140  -19.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6876  -19.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2805  -20.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7466  -20.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1583  -21.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9827  -21.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3963  -20.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9794  -19.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1565  -19.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2213  -20.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6346  -21.3648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4597  -21.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8686  -22.0781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6929  -22.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1055  -21.3620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8648  -20.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6832  -20.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9351  -19.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2721  -19.3895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6108  -19.8717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7194  -19.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3333  -20.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8897  -18.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1059  -22.7919    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.6937  -23.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8686  -23.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4566  -24.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6315  -24.2225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2194  -24.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2185  -23.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 20  1  0
 19 15  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 17 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4559997

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E1 (1877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.64Molecular Weight (Monoisotopic): 461.2362AlogP: 5.19#Rotatable Bonds: 10
Polar Surface Area: 82.62Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.58CX Basic pKa: 9.12CX LogP: 4.87CX LogD: 3.29
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.19Np Likeness Score: -1.54

References

1. Jorda R, Havlíček L, Šturc A, Tušková D, Daumová L, Alam M, Škerlová J, Nekardová M, Peřina M, Pospíšil T, Široká J, Urbánek L, Pachl P, Řezáčová P, Strnad M, Klener P, Kryštof V..  (2019)  3,5,7-Substituted Pyrazolo[4,3- d]pyrimidine Inhibitors of Cyclin-Dependent Kinases and Their Evaluation in Lymphoma Models.,  62  (9): [PMID:30943029] [10.1021/acs.jmedchem.9b00189]

Source