(1R,2S,3R,4S,5S)-1-(5-(4-Fluorophenyl)-4-(phenylamino)-7Hpyrrolo[2,3-d]pyrimidin-7-yl)-4-methylbicyclo[3.1.0]hexane-2,3-dio

ID: ALA4560021

PubChem CID: 155510479

Max Phase: Preclinical

Molecular Formula: C25H23FN4O2

Molecular Weight: 430.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1[C@@H](O)[C@@H](O)[C@@]2(n3cc(-c4ccc(F)cc4)c4c(Nc5ccccc5)ncnc43)C[C@@H]12

Standard InChI:  InChI=1S/C25H23FN4O2/c1-14-19-11-25(19,22(32)21(14)31)30-12-18(15-7-9-16(26)10-8-15)20-23(27-13-28-24(20)30)29-17-5-3-2-4-6-17/h2-10,12-14,19,21-22,31-32H,11H2,1H3,(H,27,28,29)/t14-,19-,21+,22+,25+/m0/s1

Standard InChI Key:  LQHXSAARKQNOMY-NDQDJNLBSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   16.3056   -2.9740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2837   -3.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9866   -4.2342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9647   -5.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2357   -5.4598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5287   -5.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5547   -4.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7727   -3.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2671   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7337   -5.2595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4578   -6.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9268   -6.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7566   -6.7472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4223   -7.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6527   -8.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6397   -7.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9547   -7.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6639   -6.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3091   -6.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9460   -5.8595    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0270   -2.5824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7230   -3.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4439   -2.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4660   -1.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7613   -1.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0433   -1.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5413   -3.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1087   -2.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8772   -1.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0785   -1.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5118   -2.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7463   -2.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8453   -0.7742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  2  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  6 10  1  0
 11 10  1  6
 11 12  1  0
 12 13  1  6
 12 14  1  0
 14 15  1  6
 14 16  1  0
 16 17  1  1
 16 18  1  0
 11 18  1  0
 18 19  1  0
 11 19  1  0
 18 20  1  6
  1 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  8 27  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560021

    ---

Associated Targets(Human)

ADK Tchem Adenosine kinase (1481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.48Molecular Weight (Monoisotopic): 430.1805AlogP: 4.07#Rotatable Bonds: 4
Polar Surface Area: 83.20Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.23CX Basic pKa: 4.90CX LogP: 3.95CX LogD: 3.95
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -0.16

References

1. Toti KS, Osborne D, Ciancetta A, Boison D, Jacobson KA..  (2016)  South (S)- and North (N)-Methanocarba-7-Deazaadenosine Analogues as Inhibitors of Human Adenosine Kinase.,  59  (14): [PMID:27410258] [10.1021/acs.jmedchem.6b00689]

Source