11-Deoxy alisol F 24-acetate

ID: ALA4560147

PubChem CID: 155558519

Max Phase: Preclinical

Molecular Formula: C32H50O5

Molecular Weight: 514.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]([C@@H]1C[C@@H](C)C2=C3CC[C@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]4(C)[C@@]3(C)C[C@@H]2O1)C(C)(C)O

Standard InChI:  InChI=1S/C32H50O5/c1-18-16-21(27(29(5,6)35)36-19(2)33)37-22-17-32(9)20(26(18)22)10-11-24-30(7)14-13-25(34)28(3,4)23(30)12-15-31(24,32)8/h18,21-24,27,35H,10-17H2,1-9H3/t18-,21+,22+,23+,24+,27-,30+,31+,32+/m1/s1

Standard InChI Key:  AKAICTWDPOOISW-XEDHJYNPSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   14.4164   -7.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0119   -6.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5988   -7.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3062   -5.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3062   -6.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0156   -4.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7209   -5.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7174   -6.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4236   -6.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1377   -6.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4305   -4.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1374   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1541   -3.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4358   -4.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8609   -4.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8476   -4.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6215   -5.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4235   -5.6873    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.7136   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1292   -4.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7094   -6.9131    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.8432   -5.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5949   -6.5097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6431   -3.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1160   -4.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9269   -4.4196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2712   -3.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7983   -3.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9810   -3.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5082   -2.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5189   -5.1962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.0850   -3.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5561   -4.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3699   -4.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2133   -5.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4278   -2.8614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2416   -2.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5844   -2.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7127   -3.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9581   -4.9733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4805   -2.8808    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 25  1  0
 24 15  2  0
 11 18  1  1
  7 19  1  1
 12 20  1  6
  8 21  1  6
 16 22  1  1
  5 23  2  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  6
 25 31  1  6
 27 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 32 36  1  1
 36 37  1  0
 37 38  1  0
 37 39  2  0
 33 40  1  0
 27 41  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4560147

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.75Molecular Weight (Monoisotopic): 514.3658AlogP: 6.41#Rotatable Bonds: 3
Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: 3.08

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source