2-Imino-10-methyl-N,1-bis(3-morpholinopropyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4560190

PubChem CID: 155558250

Max Phase: Preclinical

Molecular Formula: C27H37N7O4

Molecular Weight: 523.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCCN4CCOCC4)c(=N)n(CCCN4CCOCC4)c3nc12

Standard InChI:  InChI=1S/C27H37N7O4/c1-20-5-2-9-34-24(20)30-25-22(27(34)36)19-21(26(35)29-6-3-7-31-11-15-37-16-12-31)23(28)33(25)10-4-8-32-13-17-38-18-14-32/h2,5,9,19,28H,3-4,6-8,10-18H2,1H3,(H,29,35)

Standard InChI Key:  QSAQEPIFZLAQKE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    2.6579  -16.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6579  -16.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3673  -17.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3673  -15.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0767  -16.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0778  -16.9505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7821  -17.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7800  -15.7175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4930  -16.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4933  -16.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2030  -17.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9171  -16.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9168  -16.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2025  -15.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3673  -14.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7813  -18.1814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6289  -15.7188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6285  -17.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6276  -18.1850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3407  -16.9517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0521  -17.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7644  -16.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4717  -17.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1839  -16.9546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8935  -17.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6036  -16.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6087  -16.1432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8974  -15.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1811  -16.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2010  -14.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9122  -14.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9092  -13.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6155  -13.2517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3209  -13.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0251  -13.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0264  -12.4337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3174  -12.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6071  -12.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560190

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.64Molecular Weight (Monoisotopic): 523.2907AlogP: 0.61#Rotatable Bonds: 9
Polar Surface Area: 117.19Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.66CX LogP: -0.45CX LogD: -1.06
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.47

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source