The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(5-chloro-2-(2,4-dichlorophenoxy)phenoxy)butoxy)-4-methyl-2H-chromen-2-one ID: ALA4560195
PubChem CID: 155558252
Max Phase: Preclinical
Molecular Formula: C26H21Cl3O5
Molecular Weight: 519.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)ccc12
Standard InChI: InChI=1S/C26H21Cl3O5/c1-16-12-26(30)34-24-15-19(6-7-20(16)24)31-10-2-3-11-32-25-14-18(28)5-9-23(25)33-22-8-4-17(27)13-21(22)29/h4-9,12-15H,2-3,10-11H2,1H3
Standard InChI Key: DXUXCKRFMUJQHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.6772 -11.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6760 -12.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3882 -12.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0978 -12.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0950 -11.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3864 -10.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9639 -12.6228 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.3840 -10.1568 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.8053 -10.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5187 -11.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5184 -12.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2310 -12.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9422 -12.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9365 -11.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2234 -10.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6561 -12.6007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2161 -10.1426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9242 -9.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6397 -10.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3478 -9.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0633 -10.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7673 -9.7023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4828 -10.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4877 -10.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9015 -10.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1863 -9.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9115 -10.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2045 -11.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2102 -12.1441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9212 -12.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6282 -12.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6242 -11.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9258 -13.3695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3325 -10.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
6 8 1 0
5 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 23 1 0
27 28 2 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
30 33 2 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.81Molecular Weight (Monoisotopic): 518.0455AlogP: 8.09#Rotatable Bonds: 9Polar Surface Area: 57.90Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.46CX LogD: 7.46Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.63
References 1. Bekhit AA, El-Agroudy E, Helmy A, Ibrahim TM, Shavandi A, Bekhit AEA.. (2018) Leishmania treatment and prevention: Natural and synthesized drugs., 160 [PMID:30342363 ] [10.1016/j.ejmech.2018.10.022 ] 2. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V.. (2020) Natural and synthetic coumarins as antileishmanial agents: A review., 203 [PMID:32668302 ] [10.1016/j.ejmech.2020.112514 ]